C18H24Br2N2O — CID 71517724
4-(5,7-dibromoquinolin-8-yl)oxy-N,N-diethyl-3-methylbutan-1-amine (PubChem CID 71517724) has the molecular formula C18H24Br2N2O and a molecular weight of 444.21 g/mol. Its IUPAC name is 4-(5,7-dibromoquinolin-8-yl)oxy-N,N-diethyl-3-methylbutan-1-amine.
| Compound Name | 4-(5,7-dibromoquinolin-8-yl)oxy-N,N-diethyl-3-methylbutan-1-amine |
|---|---|
| PubChem CID | 71517724 |
| Molecular Formula | C18H24Br2N2O |
| Molecular Weight | 444.21 g/mol |
| Exact Mass | 442.03 |
| IUPAC Name | 4-(5,7-dibromoquinolin-8-yl)oxy-N,N-diethyl-3-methylbutan-1-amine |
| SMILES | CCN(CC)CCC(C)COc1c(Br)cc(Br)c2cccnc12 |
| InChI | InChI=1S/C18H24Br2N2O/c1-4-22(5-2)10-8-13(3)12-23-18-16(20)11-15(19)14-7-6-9-21-17(14)18/h6-7,9,11,13H,4-5,8,10,12H2,1-3H3 |
| InChIKey | XVMVFILVUZWRFV-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.21 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |