C25H33NO2 — CID 71517848
3-[4-[methyl-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)amino]phenyl]propanoic acid (PubChem CID 71517848) has the molecular formula C25H33NO2 and a molecular weight of 379.54 g/mol. Its IUPAC name is 3-[4-[methyl-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)amino]phenyl]propanoic acid.
| Compound Name | 3-[4-[methyl-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)amino]phenyl]propanoic acid |
|---|---|
| PubChem CID | 71517848 |
| Molecular Formula | C25H33NO2 |
| Molecular Weight | 379.54 g/mol |
| Exact Mass | 379.25 |
| IUPAC Name | 3-[4-[methyl-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)amino]phenyl]propanoic acid |
| SMILES | Cc1cc2c(cc1N(C)c1ccc(CCC(=O)O)cc1)C(C)(C)CCC2(C)C |
| InChI | InChI=1S/C25H33NO2/c1-17-15-20-21(25(4,5)14-13-24(20,2)3)16-22(17)26(6)19-10-7-18(8-11-19)9-12-23(27)28/h7-8,10-11,15-16H,9,12-14H2,1-6H3,(H,27,28) |
| InChIKey | NDDWHVGLJUWKNB-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.54 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |