C27H37NO2 — CID 71517849
3-[4-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)-propylamino]phenyl]propanoic acid (PubChem CID 71517849) has the molecular formula C27H37NO2 and a molecular weight of 407.60 g/mol. Its IUPAC name is 3-[4-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)-propylamino]phenyl]propanoic acid.
| Compound Name | 3-[4-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)-propylamino]phenyl]propanoic acid |
|---|---|
| PubChem CID | 71517849 |
| Molecular Formula | C27H37NO2 |
| Molecular Weight | 407.60 g/mol |
| Exact Mass | 407.28 |
| IUPAC Name | 3-[4-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)-propylamino]phenyl]propanoic acid |
| SMILES | CCCN(c1ccc(CCC(=O)O)cc1)c1cc2c(cc1C)C(C)(C)CCC2(C)C |
| InChI | InChI=1S/C27H37NO2/c1-7-16-28(21-11-8-20(9-12-21)10-13-25(29)30)24-18-23-22(17-19(24)2)26(3,4)14-15-27(23,5)6/h8-9,11-12,17-18H,7,10,13-16H2,1-6H3,(H,29,30) |
| InChIKey | DKSPXEOXZSOFFA-UHFFFAOYSA-N |
| XLogP | 6.91 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.60 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |