C18H25N7O — CID 71517860
(2S)-3-methyl-2-[[9-propan-2-yl-6-(pyridin-4-ylamino)purin-2-yl]amino]butan-1-ol (PubChem CID 71517860) has the molecular formula C18H25N7O and a molecular weight of 355.45 g/mol. Its IUPAC name is (2S)-3-methyl-2-[[9-propan-2-yl-6-(pyridin-4-ylamino)purin-2-yl]amino]butan-1-ol.
| Compound Name | (2S)-3-methyl-2-[[9-propan-2-yl-6-(pyridin-4-ylamino)purin-2-yl]amino]butan-1-ol |
|---|---|
| PubChem CID | 71517860 |
| Molecular Formula | C18H25N7O |
| Molecular Weight | 355.45 g/mol |
| Exact Mass | 355.21 |
| IUPAC Name | (2S)-3-methyl-2-[[9-propan-2-yl-6-(pyridin-4-ylamino)purin-2-yl]amino]butan-1-ol |
| SMILES | CC(C)[C@@H](CO)Nc1nc(Nc2ccncc2)c2ncn(C(C)C)c2n1 |
| InChI | InChI=1S/C18H25N7O/c1-11(2)14(9-26)22-18-23-16(21-13-5-7-19-8-6-13)15-17(24-18)25(10-20-15)12(3)4/h5-8,10-12,14,26H,9H2,1-4H3,(H2,19,21,22,23,24)/t14-/m1/s1 |
| InChIKey | NCBDOQFSGNRAHL-CQSZACIVSA-N |
| XLogP | 2.97 |
| TPSA | 100.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.45 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |