C18H19NO5 — CID 71517961
1-O-benzyl 2-O-methyl (2S,3aR,7aR)-4-oxo-3,3a,7,7a-tetrahydro-2H-indole-1,2-dicarboxylate (PubChem CID 71517961) has the molecular formula C18H19NO5 and a molecular weight of 329.35 g/mol. Its IUPAC name is 1-O-benzyl 2-O-methyl (2S,3aR,7aR)-4-oxo-3,3a,7,7a-tetrahydro-2H-indole-1,2-dicarboxylate.
| Compound Name | 1-O-benzyl 2-O-methyl (2S,3aR,7aR)-4-oxo-3,3a,7,7a-tetrahydro-2H-indole-1,2-dicarboxylate |
|---|---|
| PubChem CID | 71517961 |
| Molecular Formula | C18H19NO5 |
| Molecular Weight | 329.35 g/mol |
| Exact Mass | 329.13 |
| IUPAC Name | 1-O-benzyl 2-O-methyl (2S,3aR,7aR)-4-oxo-3,3a,7,7a-tetrahydro-2H-indole-1,2-dicarboxylate |
| SMILES | COC(=O)[C@@H]1C[C@H]2C(=O)C=CC[C@H]2N1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C18H19NO5/c1-23-17(21)15-10-13-14(8-5-9-16(13)20)19(15)18(22)24-11-12-6-3-2-4-7-12/h2-7,9,13-15H,8,10-11H2,1H3/t13-,14-,15+/m1/s1 |
| InChIKey | LLLGKWYSVIONGP-KFWWJZLASA-N |
| XLogP | 2.08 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.35 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |