C18H19NO6 — CID 71518130
1-O-benzyl 2-O-methyl (2S,3aR,7R,7aS)-7-hydroxy-4-oxo-3,3a,7,7a-tetrahydro-2H-indole-1,2-dicarboxylate (PubChem CID 71518130) has the molecular formula C18H19NO6 and a molecular weight of 345.35 g/mol. Its IUPAC name is 1-O-benzyl 2-O-methyl (2S,3aR,7R,7aS)-7-hydroxy-4-oxo-3,3a,7,7a-tetrahydro-2H-indole-1,2-dicarboxylate.
| Compound Name | 1-O-benzyl 2-O-methyl (2S,3aR,7R,7aS)-7-hydroxy-4-oxo-3,3a,7,7a-tetrahydro-2H-indole-1,2-dicarboxylate |
|---|---|
| PubChem CID | 71518130 |
| Molecular Formula | C18H19NO6 |
| Molecular Weight | 345.35 g/mol |
| Exact Mass | 345.12 |
| IUPAC Name | 1-O-benzyl 2-O-methyl (2S,3aR,7R,7aS)-7-hydroxy-4-oxo-3,3a,7,7a-tetrahydro-2H-indole-1,2-dicarboxylate |
| SMILES | COC(=O)[C@@H]1C[C@H]2C(=O)C=C[C@@H](O)[C@H]2N1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C18H19NO6/c1-24-17(22)13-9-12-14(20)7-8-15(21)16(12)19(13)18(23)25-10-11-5-3-2-4-6-11/h2-8,12-13,15-16,21H,9-10H2,1H3/t12-,13-,15+,16-/m0/s1 |
| InChIKey | WILGAKVMSCEBSL-UGQVUOCMSA-N |
| XLogP | 1.06 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.35 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |