C22H25F3N2O4S — CID 71518398
(3aS,9bR)-2-[[(1S,4R)-7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl]methylsulfonyl]-6-(trifluoromethyl)-3,3a,4,9b-tetrahydro-1H-pyrrolo[3,4-c]isoquinolin-5-one (PubChem CID 71518398) has the molecular formula C22H25F3N2O4S and a molecular weight of 470.51 g/mol. Its IUPAC name is (3aS,9bR)-2-[[(1S,4R)-7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl]methylsulfonyl]-6-(trifluoromethyl)-3,3a,4,9b-tetrahydro-1H-pyrrolo[3,4-c]isoquinolin-5-one.
| Compound Name | (3aS,9bR)-2-[[(1S,4R)-7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl]methylsulfonyl]-6-(trifluoromethyl)-3,3a,4,9b-tetrahydro-1H-pyrrolo[3,4-c]isoquinolin-5-one |
|---|---|
| PubChem CID | 71518398 |
| Molecular Formula | C22H25F3N2O4S |
| Molecular Weight | 470.51 g/mol |
| Exact Mass | 470.15 |
| IUPAC Name | (3aS,9bR)-2-[[(1S,4R)-7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl]methylsulfonyl]-6-(trifluoromethyl)-3,3a,4,9b-tetrahydro-1H-pyrrolo[3,4-c]isoquinolin-5-one |
| SMILES | CC1(C)[C@@H]2CC[C@@]1(CS(=O)(=O)N1C[C@H]3NC(=O)c4c(cccc4C(F)(F)F)[C@@H]3C1)C(=O)C2 |
| InChI | InChI=1S/C22H25F3N2O4S/c1-20(2)12-6-7-21(20,17(28)8-12)11-32(30,31)27-9-14-13-4-3-5-15(22(23,24)25)18(13)19(29)26-16(14)10-27/h3-5,12,14,16H,6-11H2,1-2H3,(H,26,29)/t12-,14+,16-,21-/m1/s1 |
| InChIKey | ATGGUAORGXXBHJ-GDCLHMSGSA-N |
| XLogP | 2.94 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.51 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |