C25H34F3N3O — CID 71518408
[(2R,3aR,6aR)-2-(cycloheptylamino)-2,3,4,5,6,6a-hexahydro-1H-pentalen-3a-yl]-[3-(trifluoromethyl)-7,8-dihydro-5H-1,6-naphthyridin-6-yl]methanone (PubChem CID 71518408) has the molecular formula C25H34F3N3O and a molecular weight of 449.56 g/mol. Its IUPAC name is [(2R,3aR,6aR)-2-(cycloheptylamino)-2,3,4,5,6,6a-hexahydro-1H-pentalen-3a-yl]-[3-(trifluoromethyl)-7,8-dihydro-5H-1,6-naphthyridin-6-yl]methanone.
| Compound Name | [(2R,3aR,6aR)-2-(cycloheptylamino)-2,3,4,5,6,6a-hexahydro-1H-pentalen-3a-yl]-[3-(trifluoromethyl)-7,8-dihydro-5H-1,6-naphthyridin-6-yl]methanone |
|---|---|
| PubChem CID | 71518408 |
| Molecular Formula | C25H34F3N3O |
| Molecular Weight | 449.56 g/mol |
| Exact Mass | 449.27 |
| IUPAC Name | [(2R,3aR,6aR)-2-(cycloheptylamino)-2,3,4,5,6,6a-hexahydro-1H-pentalen-3a-yl]-[3-(trifluoromethyl)-7,8-dihydro-5H-1,6-naphthyridin-6-yl]methanone |
| SMILES | O=C(N1CCc2ncc(C(F)(F)F)cc2C1)[C@@]12CCC[C@@H]1C[C@@H](NC1CCCCCC1)C2 |
| InChI | InChI=1S/C25H34F3N3O/c26-25(27,28)19-12-17-16-31(11-9-22(17)29-15-19)23(32)24-10-5-6-18(24)13-21(14-24)30-20-7-3-1-2-4-8-20/h12,15,18,20-21,30H,1-11,13-14,16H2/t18-,21-,24-/m1/s1 |
| InChIKey | ZYQVKVVQGPZOLB-MEKIYTOJSA-N |
| XLogP | 5.25 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.56 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |