C15H22O2 — CID 71518468
(3aS,7aR)-7a-ethynyl-7,7-dimethylspiro[1,2,3,3a,4,6-hexahydroindene-5,2'-1,3-dioxolane] (PubChem CID 71518468) has the molecular formula C15H22O2 and a molecular weight of 234.34 g/mol. Its IUPAC name is (3aS,7aR)-7a-ethynyl-7,7-dimethylspiro[1,2,3,3a,4,6-hexahydroindene-5,2'-1,3-dioxolane].
| Compound Name | (3aS,7aR)-7a-ethynyl-7,7-dimethylspiro[1,2,3,3a,4,6-hexahydroindene-5,2'-1,3-dioxolane] |
|---|---|
| PubChem CID | 71518468 |
| Molecular Formula | C15H22O2 |
| Molecular Weight | 234.34 g/mol |
| Exact Mass | 234.16 |
| IUPAC Name | (3aS,7aR)-7a-ethynyl-7,7-dimethylspiro[1,2,3,3a,4,6-hexahydroindene-5,2'-1,3-dioxolane] |
| SMILES | C#C[C@]12CCC[C@H]1CC1(CC2(C)C)OCCO1 |
| InChI | InChI=1S/C15H22O2/c1-4-14-7-5-6-12(14)10-15(11-13(14,2)3)16-8-9-17-15/h1,12H,5-11H2,2-3H3/t12-,14-/m0/s1 |
| InChIKey | VRDSSYSFBMUVON-JSGCOSHPSA-N |
| XLogP | 2.97 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.34 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|