About 9-propan-2-yl-2-N,6-N-di(pyrimidin-5-yl)purine-2,6-diamine
9-propan-2-yl-2-N,6-N-di(pyrimidin-5-yl)purine-2,6-diamine (PubChem CID 71518533) has the molecular formula C16H16N10
and a molecular weight of 348.37 g/mol. Its IUPAC name is 9-propan-2-yl-2-N,6-N-di(pyrimidin-5-yl)purine-2,6-diamine.
Molecular Properties
| Compound Name | 9-propan-2-yl-2-N,6-N-di(pyrimidin-5-yl)purine-2,6-diamine |
| PubChem CID | 71518533 |
| Molecular Formula | C16H16N10 |
| Molecular Weight | 348.37 g/mol |
| Exact Mass | 348.16 |
| IUPAC Name | 9-propan-2-yl-2-N,6-N-di(pyrimidin-5-yl)purine-2,6-diamine |
| SMILES | CC(C)n1cnc2c(Nc3cncnc3)nc(Nc3cncnc3)nc21 |
| InChI | InChI=1S/C16H16N10/c1-10(2)26-9-21-13-14(22-11-3-17-7-18-4-11)24-16(25-15(13)26)23-12-5-19-8-20-6-12/h3-10H,1-2H3,(H2,22,23,24,25) |
| InChIKey | BUKNIOLWHFXEIG-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 119.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 348.37 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
Analyze 9-propan-2-yl-2-N,6-N-di(pyrimidin-5-yl)purine-2,6-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-propan-2-yl-2-N,6-N-di(pyrimidin-5-yl)purine-2,6-diamine?
The IUPAC name of 9-propan-2-yl-2-N,6-N-di(pyrimidin-5-yl)purine-2,6-diamine (CID 71518533) is 9-propan-2-yl-2-N,6-N-di(pyrimidin-5-yl)purine-2,6-diamine.
What is the SMILES notation for 9-propan-2-yl-2-N,6-N-di(pyrimidin-5-yl)purine-2,6-diamine?
The canonical SMILES for 9-propan-2-yl-2-N,6-N-di(pyrimidin-5-yl)purine-2,6-diamine is CC(C)n1cnc2c(Nc3cncnc3)nc(Nc3cncnc3)nc21.
What is the InChIKey of 9-propan-2-yl-2-N,6-N-di(pyrimidin-5-yl)purine-2,6-diamine?
The InChIKey is BUKNIOLWHFXEIG-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16N10/c1-10(2)26-9-21-13-14(22-11-3-17-7-18-4-11)24-16(25-15(13)26)23-12-5-19-8-20-6-12/h3-10H,1-2H3,(H2,22,23,24,25).
What are the key properties of 9-propan-2-yl-2-N,6-N-di(pyrimidin-5-yl)purine-2,6-diamine?
9-propan-2-yl-2-N,6-N-di(pyrimidin-5-yl)purine-2,6-diamine has a molecular weight of 348.37 g/mol, XLogP of 2.47, 5 rotatable bonds, 2 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for 9-propan-2-yl-2-N,6-N-di(pyrimidin-5-yl)purine-2,6-diamine is sourced from PubChem (CID 71518533), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).