C24H32F3N3O2 — CID 71518572
[(2R,3aR,6aR)-2-(oxan-4-ylmethylamino)-2,3,4,5,6,6a-hexahydro-1H-pentalen-3a-yl]-[3-(trifluoromethyl)-7,8-dihydro-5H-1,6-naphthyridin-6-yl]methanone (PubChem CID 71518572) has the molecular formula C24H32F3N3O2 and a molecular weight of 451.53 g/mol. Its IUPAC name is [(2R,3aR,6aR)-2-(oxan-4-ylmethylamino)-2,3,4,5,6,6a-hexahydro-1H-pentalen-3a-yl]-[3-(trifluoromethyl)-7,8-dihydro-5H-1,6-naphthyridin-6-yl]methanone.
| Compound Name | [(2R,3aR,6aR)-2-(oxan-4-ylmethylamino)-2,3,4,5,6,6a-hexahydro-1H-pentalen-3a-yl]-[3-(trifluoromethyl)-7,8-dihydro-5H-1,6-naphthyridin-6-yl]methanone |
|---|---|
| PubChem CID | 71518572 |
| Molecular Formula | C24H32F3N3O2 |
| Molecular Weight | 451.53 g/mol |
| Exact Mass | 451.24 |
| IUPAC Name | [(2R,3aR,6aR)-2-(oxan-4-ylmethylamino)-2,3,4,5,6,6a-hexahydro-1H-pentalen-3a-yl]-[3-(trifluoromethyl)-7,8-dihydro-5H-1,6-naphthyridin-6-yl]methanone |
| SMILES | O=C(N1CCc2ncc(C(F)(F)F)cc2C1)[C@@]12CCC[C@@H]1C[C@@H](NCC1CCOCC1)C2 |
| InChI | InChI=1S/C24H32F3N3O2/c25-24(26,27)19-10-17-15-30(7-3-21(17)29-14-19)22(31)23-6-1-2-18(23)11-20(12-23)28-13-16-4-8-32-9-5-16/h10,14,16,18,20,28H,1-9,11-13,15H2/t18-,20-,23-/m1/s1 |
| InChIKey | JPJOUNRFXKWELV-KKLQWCBXSA-N |
| XLogP | 3.95 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.53 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |