C24H30F3N3O3 — CID 71518573
N-[(2R,3aR,6aR)-6a-[3-(trifluoromethyl)-7,8-dihydro-5H-1,6-naphthyridine-6-carbonyl]-2,3,3a,4,5,6-hexahydro-1H-pentalen-2-yl]oxane-4-carboxamide (PubChem CID 71518573) has the molecular formula C24H30F3N3O3 and a molecular weight of 465.52 g/mol. Its IUPAC name is N-[(2R,3aR,6aR)-6a-[3-(trifluoromethyl)-7,8-dihydro-5H-1,6-naphthyridine-6-carbonyl]-2,3,3a,4,5,6-hexahydro-1H-pentalen-2-yl]oxane-4-carboxamide.
| Compound Name | N-[(2R,3aR,6aR)-6a-[3-(trifluoromethyl)-7,8-dihydro-5H-1,6-naphthyridine-6-carbonyl]-2,3,3a,4,5,6-hexahydro-1H-pentalen-2-yl]oxane-4-carboxamide |
|---|---|
| PubChem CID | 71518573 |
| Molecular Formula | C24H30F3N3O3 |
| Molecular Weight | 465.52 g/mol |
| Exact Mass | 465.22 |
| IUPAC Name | N-[(2R,3aR,6aR)-6a-[3-(trifluoromethyl)-7,8-dihydro-5H-1,6-naphthyridine-6-carbonyl]-2,3,3a,4,5,6-hexahydro-1H-pentalen-2-yl]oxane-4-carboxamide |
| SMILES | O=C(N[C@@H]1C[C@H]2CCC[C@@]2(C(=O)N2CCc3ncc(C(F)(F)F)cc3C2)C1)C1CCOCC1 |
| InChI | InChI=1S/C24H30F3N3O3/c25-24(26,27)18-10-16-14-30(7-3-20(16)28-13-18)22(32)23-6-1-2-17(23)11-19(12-23)29-21(31)15-4-8-33-9-5-15/h10,13,15,17,19H,1-9,11-12,14H2,(H,29,31)/t17-,19-,23-/m1/s1 |
| InChIKey | GLWFJEKSPATKBS-LYHRCORUSA-N |
| XLogP | 3.48 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.52 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |