About (3E)-3-[iodo(phenyl)methylidene]-N-phenylfuro[3,4-c]pyridin-1-imine
(3E)-3-[iodo(phenyl)methylidene]-N-phenylfuro[3,4-c]pyridin-1-imine (PubChem CID 71518983) has the molecular formula C20H13IN2O
and a molecular weight of 424.24 g/mol. Its IUPAC name is (3E)-3-[iodo(phenyl)methylidene]-N-phenylfuro[3,4-c]pyridin-1-imine.
Molecular Properties
| Compound Name | (3E)-3-[iodo(phenyl)methylidene]-N-phenylfuro[3,4-c]pyridin-1-imine |
| PubChem CID | 71518983 |
| Molecular Formula | C20H13IN2O |
| Molecular Weight | 424.24 g/mol |
| Exact Mass | 424.01 |
| IUPAC Name | (3E)-3-[iodo(phenyl)methylidene]-N-phenylfuro[3,4-c]pyridin-1-imine |
| SMILES | I/C(=C1/O/C(=N\c2ccccc2)c2ccncc21)c1ccccc1 |
| InChI | InChI=1S/C20H13IN2O/c21-18(14-7-3-1-4-8-14)19-17-13-22-12-11-16(17)20(24-19)23-15-9-5-2-6-10-15/h1-13H/b19-18+,23-20- |
| InChIKey | GXRUVLPHWNXITD-BMUZNATDSA-N |
| XLogP | 5.45 |
| TPSA | 34.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 424.24 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze (3E)-3-[iodo(phenyl)methylidene]-N-phenylfuro[3,4-c]pyridin-1-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3E)-3-[iodo(phenyl)methylidene]-N-phenylfuro[3,4-c]pyridin-1-imine?
The IUPAC name of (3E)-3-[iodo(phenyl)methylidene]-N-phenylfuro[3,4-c]pyridin-1-imine (CID 71518983) is (3E)-3-[iodo(phenyl)methylidene]-N-phenylfuro[3,4-c]pyridin-1-imine.
What is the SMILES notation for (3E)-3-[iodo(phenyl)methylidene]-N-phenylfuro[3,4-c]pyridin-1-imine?
The canonical SMILES for (3E)-3-[iodo(phenyl)methylidene]-N-phenylfuro[3,4-c]pyridin-1-imine is I/C(=C1/O/C(=N\c2ccccc2)c2ccncc21)c1ccccc1.
What is the InChIKey of (3E)-3-[iodo(phenyl)methylidene]-N-phenylfuro[3,4-c]pyridin-1-imine?
The InChIKey is GXRUVLPHWNXITD-BMUZNATDSA-N. The full InChI is InChI=1S/C20H13IN2O/c21-18(14-7-3-1-4-8-14)19-17-13-22-12-11-16(17)20(24-19)23-15-9-5-2-6-10-15/h1-13H/b19-18+,23-20-.
What are the key properties of (3E)-3-[iodo(phenyl)methylidene]-N-phenylfuro[3,4-c]pyridin-1-imine?
(3E)-3-[iodo(phenyl)methylidene]-N-phenylfuro[3,4-c]pyridin-1-imine has a molecular weight of 424.24 g/mol, XLogP of 5.45, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3E)-3-[iodo(phenyl)methylidene]-N-phenylfuro[3,4-c]pyridin-1-imine is sourced from PubChem (CID 71518983), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).