C33H36N4O3 — CID 71519005
(2E,5E)-2,5-bis[[4-(4-imidazol-1-ylbutoxy)phenyl]methylidene]cyclopentan-1-one (PubChem CID 71519005) has the molecular formula C33H36N4O3 and a molecular weight of 536.68 g/mol. Its IUPAC name is (2E,5E)-2,5-bis[[4-(4-imidazol-1-ylbutoxy)phenyl]methylidene]cyclopentan-1-one.
| Compound Name | (2E,5E)-2,5-bis[[4-(4-imidazol-1-ylbutoxy)phenyl]methylidene]cyclopentan-1-one |
|---|---|
| PubChem CID | 71519005 |
| Molecular Formula | C33H36N4O3 |
| Molecular Weight | 536.68 g/mol |
| Exact Mass | 536.28 |
| IUPAC Name | (2E,5E)-2,5-bis[[4-(4-imidazol-1-ylbutoxy)phenyl]methylidene]cyclopentan-1-one |
| SMILES | O=C1/C(=C/c2ccc(OCCCCn3ccnc3)cc2)CC/C1=C\c1ccc(OCCCCn2ccnc2)cc1 |
| InChI | InChI=1S/C33H36N4O3/c38-33-29(23-27-5-11-31(12-6-27)39-21-3-1-17-36-19-15-34-25-36)9-10-30(33)24-28-7-13-32(14-8-28)40-22-4-2-18-37-20-16-35-26-37/h5-8,11-16,19-20,23-26H,1-4,9-10,17-18,21-22H2/b29-23+,30-24+ |
| InChIKey | LZCXLSPTXFIQCF-HCTXVGCHSA-N |
| XLogP | 6.63 |
| TPSA | 71.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.68 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|