C25H35NO6 — CID 71519008
(2R,3S)-3-hydroxy-2-[[6-hydroxy-5-[(E)-3-methyl-5-[(1R,2S)-1,2,3-trimethylcyclohex-3-en-1-yl]pent-2-enyl]-3,4-dioxocyclohexa-1,5-dien-1-yl]amino]butanoic acid (PubChem CID 71519008) has the molecular formula C25H35NO6 and a molecular weight of 445.56 g/mol. Its IUPAC name is (2R,3S)-3-hydroxy-2-[[6-hydroxy-5-[(E)-3-methyl-5-[(1R,2S)-1,2,3-trimethylcyclohex-3-en-1-yl]pent-2-enyl]-3,4-dioxocyclohexa-1,5-dien-1-yl]amino]butanoic acid.
| Compound Name | (2R,3S)-3-hydroxy-2-[[6-hydroxy-5-[(E)-3-methyl-5-[(1R,2S)-1,2,3-trimethylcyclohex-3-en-1-yl]pent-2-enyl]-3,4-dioxocyclohexa-1,5-dien-1-yl]amino]butanoic acid |
|---|---|
| PubChem CID | 71519008 |
| Molecular Formula | C25H35NO6 |
| Molecular Weight | 445.56 g/mol |
| Exact Mass | 445.25 |
| IUPAC Name | (2R,3S)-3-hydroxy-2-[[6-hydroxy-5-[(E)-3-methyl-5-[(1R,2S)-1,2,3-trimethylcyclohex-3-en-1-yl]pent-2-enyl]-3,4-dioxocyclohexa-1,5-dien-1-yl]amino]butanoic acid |
| SMILES | CC1=CCC[C@](C)(CC/C(C)=C/CC2=C(O)C(N[C@@H](C(=O)O)[C@H](C)O)=CC(=O)C2=O)[C@@H]1C |
| InChI | InChI=1S/C25H35NO6/c1-14(10-12-25(5)11-6-7-15(2)16(25)3)8-9-18-22(29)19(13-20(28)23(18)30)26-21(17(4)27)24(31)32/h7-8,13,16-17,21,26-27,29H,6,9-12H2,1-5H3,(H,31,32)/b14-8+/t16-,17+,21-,25-/m1/s1 |
| InChIKey | ZGTMGVUGHSGLKM-GYAOZCJBSA-N |
| XLogP | 3.76 |
| TPSA | 123.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.56 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'chinone_2', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|