C21H18O3 — CID 71519320
6-methyl-3,3-diphenyl-6,7-dihydro-5H-1-benzofuran-2,4-dione (PubChem CID 71519320) has the molecular formula C21H18O3 and a molecular weight of 318.37 g/mol. Its IUPAC name is 6-methyl-3,3-diphenyl-6,7-dihydro-5H-1-benzofuran-2,4-dione.
| Compound Name | 6-methyl-3,3-diphenyl-6,7-dihydro-5H-1-benzofuran-2,4-dione |
|---|---|
| PubChem CID | 71519320 |
| Molecular Formula | C21H18O3 |
| Molecular Weight | 318.37 g/mol |
| Exact Mass | 318.13 |
| IUPAC Name | 6-methyl-3,3-diphenyl-6,7-dihydro-5H-1-benzofuran-2,4-dione |
| SMILES | CC1CC(=O)C2=C(C1)OC(=O)C2(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H18O3/c1-14-12-17(22)19-18(13-14)24-20(23)21(19,15-8-4-2-5-9-15)16-10-6-3-7-11-16/h2-11,14H,12-13H2,1H3 |
| InChIKey | BYYBGXGISTYHDK-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.37 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |