About 7-benzyl-4-piperazin-1-ylpyrrolo[2,3-d]pyrimidin-2-amine
7-benzyl-4-piperazin-1-ylpyrrolo[2,3-d]pyrimidin-2-amine (PubChem CID 71519348) has the molecular formula C17H20N6
and a molecular weight of 308.39 g/mol. Its IUPAC name is 7-benzyl-4-piperazin-1-ylpyrrolo[2,3-d]pyrimidin-2-amine.
Molecular Properties
| Compound Name | 7-benzyl-4-piperazin-1-ylpyrrolo[2,3-d]pyrimidin-2-amine |
| PubChem CID | 71519348 |
| Molecular Formula | C17H20N6 |
| Molecular Weight | 308.39 g/mol |
| Exact Mass | 308.17 |
| IUPAC Name | 7-benzyl-4-piperazin-1-ylpyrrolo[2,3-d]pyrimidin-2-amine |
| SMILES | Nc1nc(N2CCNCC2)c2ccn(Cc3ccccc3)c2n1 |
| InChI | InChI=1S/C17H20N6/c18-17-20-15(22-10-7-19-8-11-22)14-6-9-23(16(14)21-17)12-13-4-2-1-3-5-13/h1-6,9,19H,7-8,10-12H2,(H2,18,20,21) |
| InChIKey | JGAIGKSTYRMIPG-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 72.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.39 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 7-benzyl-4-piperazin-1-ylpyrrolo[2,3-d]pyrimidin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-benzyl-4-piperazin-1-ylpyrrolo[2,3-d]pyrimidin-2-amine?
The IUPAC name of 7-benzyl-4-piperazin-1-ylpyrrolo[2,3-d]pyrimidin-2-amine (CID 71519348) is 7-benzyl-4-piperazin-1-ylpyrrolo[2,3-d]pyrimidin-2-amine.
What is the SMILES notation for 7-benzyl-4-piperazin-1-ylpyrrolo[2,3-d]pyrimidin-2-amine?
The canonical SMILES for 7-benzyl-4-piperazin-1-ylpyrrolo[2,3-d]pyrimidin-2-amine is Nc1nc(N2CCNCC2)c2ccn(Cc3ccccc3)c2n1.
What is the InChIKey of 7-benzyl-4-piperazin-1-ylpyrrolo[2,3-d]pyrimidin-2-amine?
The InChIKey is JGAIGKSTYRMIPG-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H20N6/c18-17-20-15(22-10-7-19-8-11-22)14-6-9-23(16(14)21-17)12-13-4-2-1-3-5-13/h1-6,9,19H,7-8,10-12H2,(H2,18,20,21).
What are the key properties of 7-benzyl-4-piperazin-1-ylpyrrolo[2,3-d]pyrimidin-2-amine?
7-benzyl-4-piperazin-1-ylpyrrolo[2,3-d]pyrimidin-2-amine has a molecular weight of 308.39 g/mol, XLogP of 1.47, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 7-benzyl-4-piperazin-1-ylpyrrolo[2,3-d]pyrimidin-2-amine is sourced from PubChem (CID 71519348), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).