C29H34N2O3 — CID 71519360
1-phenyl-5-(3,4,5-trimethoxyphenyl)-3-[(E)-2-(2,6,6-trimethylcyclohex-2-en-1-yl)ethenyl]pyrazole (PubChem CID 71519360) has the molecular formula C29H34N2O3 and a molecular weight of 458.60 g/mol. Its IUPAC name is 1-phenyl-5-(3,4,5-trimethoxyphenyl)-3-[(E)-2-(2,6,6-trimethylcyclohex-2-en-1-yl)ethenyl]pyrazole.
| Compound Name | 1-phenyl-5-(3,4,5-trimethoxyphenyl)-3-[(E)-2-(2,6,6-trimethylcyclohex-2-en-1-yl)ethenyl]pyrazole |
|---|---|
| PubChem CID | 71519360 |
| Molecular Formula | C29H34N2O3 |
| Molecular Weight | 458.60 g/mol |
| Exact Mass | 458.26 |
| IUPAC Name | 1-phenyl-5-(3,4,5-trimethoxyphenyl)-3-[(E)-2-(2,6,6-trimethylcyclohex-2-en-1-yl)ethenyl]pyrazole |
| SMILES | COc1cc(-c2cc(/C=C/C3C(C)=CCCC3(C)C)nn2-c2ccccc2)cc(OC)c1OC |
| InChI | InChI=1S/C29H34N2O3/c1-20-11-10-16-29(2,3)24(20)15-14-22-19-25(31(30-22)23-12-8-7-9-13-23)21-17-26(32-4)28(34-6)27(18-21)33-5/h7-9,11-15,17-19,24H,10,16H2,1-6H3/b15-14+ |
| InChIKey | MUCDUUGEQHZEIN-CCEZHUSRSA-N |
| XLogP | 6.96 |
| TPSA | 45.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.60 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|