C23H30F3N3O3 — CID 71519385
tert-butyl N-[(2R,3aR,6aR)-6a-[3-(trifluoromethyl)-7,8-dihydro-5H-1,6-naphthyridine-6-carbonyl]-2,3,3a,4,5,6-hexahydro-1H-pentalen-2-yl]carbamate (PubChem CID 71519385) has the molecular formula C23H30F3N3O3 and a molecular weight of 453.51 g/mol. Its IUPAC name is tert-butyl N-[(2R,3aR,6aR)-6a-[3-(trifluoromethyl)-7,8-dihydro-5H-1,6-naphthyridine-6-carbonyl]-2,3,3a,4,5,6-hexahydro-1H-pentalen-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2R,3aR,6aR)-6a-[3-(trifluoromethyl)-7,8-dihydro-5H-1,6-naphthyridine-6-carbonyl]-2,3,3a,4,5,6-hexahydro-1H-pentalen-2-yl]carbamate |
|---|---|
| PubChem CID | 71519385 |
| Molecular Formula | C23H30F3N3O3 |
| Molecular Weight | 453.51 g/mol |
| Exact Mass | 453.22 |
| IUPAC Name | tert-butyl N-[(2R,3aR,6aR)-6a-[3-(trifluoromethyl)-7,8-dihydro-5H-1,6-naphthyridine-6-carbonyl]-2,3,3a,4,5,6-hexahydro-1H-pentalen-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H]1C[C@H]2CCC[C@@]2(C(=O)N2CCc3ncc(C(F)(F)F)cc3C2)C1 |
| InChI | InChI=1S/C23H30F3N3O3/c1-21(2,3)32-20(31)28-17-10-15-5-4-7-22(15,11-17)19(30)29-8-6-18-14(13-29)9-16(12-27-18)23(24,25)26/h9,12,15,17H,4-8,10-11,13H2,1-3H3,(H,28,31)/t15-,17-,22-/m1/s1 |
| InChIKey | BKBRZCOSQKKMGU-ZDPZECHZSA-N |
| XLogP | 4.46 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.51 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |