C24H22N4O3S — CID 71519483
7-(4-methylsulfonylphenyl)-4-[[(1R)-1-phenylethyl]amino]cinnoline-3-carboxamide (PubChem CID 71519483) has the molecular formula C24H22N4O3S and a molecular weight of 446.53 g/mol. Its IUPAC name is 7-(4-methylsulfonylphenyl)-4-[[(1R)-1-phenylethyl]amino]cinnoline-3-carboxamide.
| Compound Name | 7-(4-methylsulfonylphenyl)-4-[[(1R)-1-phenylethyl]amino]cinnoline-3-carboxamide |
|---|---|
| PubChem CID | 71519483 |
| Molecular Formula | C24H22N4O3S |
| Molecular Weight | 446.53 g/mol |
| Exact Mass | 446.14 |
| IUPAC Name | 7-(4-methylsulfonylphenyl)-4-[[(1R)-1-phenylethyl]amino]cinnoline-3-carboxamide |
| SMILES | C[C@@H](Nc1c(C(N)=O)nnc2cc(-c3ccc(S(C)(=O)=O)cc3)ccc12)c1ccccc1 |
| InChI | InChI=1S/C24H22N4O3S/c1-15(16-6-4-3-5-7-16)26-22-20-13-10-18(14-21(20)27-28-23(22)24(25)29)17-8-11-19(12-9-17)32(2,30)31/h3-15H,1-2H3,(H2,25,29)(H,26,27)/t15-/m1/s1 |
| InChIKey | LJDRUYMIGWBCNB-OAHLLOKOSA-N |
| XLogP | 3.97 |
| TPSA | 115.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.53 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |