C19H9ClN2O6 — CID 71520246
4-chloro-N-(2,4-dioxo-3-oxatricyclo[7.3.1.05,13]trideca-1(12),5(13),6,8,10-pentaen-7-yl)-3-nitrobenzamide (PubChem CID 71520246) has the molecular formula C19H9ClN2O6 and a molecular weight of 396.74 g/mol. Its IUPAC name is 4-chloro-N-(2,4-dioxo-3-oxatricyclo[7.3.1.05,13]trideca-1(12),5(13),6,8,10-pentaen-7-yl)-3-nitrobenzamide.
| Compound Name | 4-chloro-N-(2,4-dioxo-3-oxatricyclo[7.3.1.05,13]trideca-1(12),5(13),6,8,10-pentaen-7-yl)-3-nitrobenzamide |
|---|---|
| PubChem CID | 71520246 |
| Molecular Formula | C19H9ClN2O6 |
| Molecular Weight | 396.74 g/mol |
| Exact Mass | 396.01 |
| IUPAC Name | 4-chloro-N-(2,4-dioxo-3-oxatricyclo[7.3.1.05,13]trideca-1(12),5(13),6,8,10-pentaen-7-yl)-3-nitrobenzamide |
| SMILES | O=C(Nc1cc2c3c(cccc3c1)C(=O)OC2=O)c1ccc(Cl)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C19H9ClN2O6/c20-14-5-4-10(7-15(14)22(26)27)17(23)21-11-6-9-2-1-3-12-16(9)13(8-11)19(25)28-18(12)24/h1-8H,(H,21,23) |
| InChIKey | WKLAJLRCAMPMGT-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 115.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.74 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|