C20H13NO5S — CID 71520365
(E)-N-(2,4-dioxo-3-oxatricyclo[7.3.1.05,13]trideca-1(12),5(13),6,8,10-pentaen-7-yl)-2-phenylethenesulfonamide (PubChem CID 71520365) has the molecular formula C20H13NO5S and a molecular weight of 379.39 g/mol. Its IUPAC name is (E)-N-(2,4-dioxo-3-oxatricyclo[7.3.1.05,13]trideca-1(12),5(13),6,8,10-pentaen-7-yl)-2-phenylethenesulfonamide.
| Compound Name | (E)-N-(2,4-dioxo-3-oxatricyclo[7.3.1.05,13]trideca-1(12),5(13),6,8,10-pentaen-7-yl)-2-phenylethenesulfonamide |
|---|---|
| PubChem CID | 71520365 |
| Molecular Formula | C20H13NO5S |
| Molecular Weight | 379.39 g/mol |
| Exact Mass | 379.05 |
| IUPAC Name | (E)-N-(2,4-dioxo-3-oxatricyclo[7.3.1.05,13]trideca-1(12),5(13),6,8,10-pentaen-7-yl)-2-phenylethenesulfonamide |
| SMILES | O=C1OC(=O)c2cc(NS(=O)(=O)/C=C/c3ccccc3)cc3cccc1c23 |
| InChI | InChI=1S/C20H13NO5S/c22-19-16-8-4-7-14-11-15(12-17(18(14)16)20(23)26-19)21-27(24,25)10-9-13-5-2-1-3-6-13/h1-12,21H/b10-9+ |
| InChIKey | SMYBPPBIOQBGQO-MDZDMXLPSA-N |
| XLogP | 3.56 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.39 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|