C21H12ClNO4 — CID 71520366
(E)-3-(2-chlorophenyl)-N-(2,4-dioxo-3-oxatricyclo[7.3.1.05,13]trideca-1(12),5(13),6,8,10-pentaen-7-yl)prop-2-enamide (PubChem CID 71520366) has the molecular formula C21H12ClNO4 and a molecular weight of 377.78 g/mol. Its IUPAC name is (E)-3-(2-chlorophenyl)-N-(2,4-dioxo-3-oxatricyclo[7.3.1.05,13]trideca-1(12),5(13),6,8,10-pentaen-7-yl)prop-2-enamide.
| Compound Name | (E)-3-(2-chlorophenyl)-N-(2,4-dioxo-3-oxatricyclo[7.3.1.05,13]trideca-1(12),5(13),6,8,10-pentaen-7-yl)prop-2-enamide |
|---|---|
| PubChem CID | 71520366 |
| Molecular Formula | C21H12ClNO4 |
| Molecular Weight | 377.78 g/mol |
| Exact Mass | 377.05 |
| IUPAC Name | (E)-3-(2-chlorophenyl)-N-(2,4-dioxo-3-oxatricyclo[7.3.1.05,13]trideca-1(12),5(13),6,8,10-pentaen-7-yl)prop-2-enamide |
| SMILES | O=C(/C=C/c1ccccc1Cl)Nc1cc2c3c(cccc3c1)C(=O)OC2=O |
| InChI | InChI=1S/C21H12ClNO4/c22-17-7-2-1-4-12(17)8-9-18(24)23-14-10-13-5-3-6-15-19(13)16(11-14)21(26)27-20(15)25/h1-11H,(H,23,24)/b9-8+ |
| InChIKey | KLVDRZSOVYSBFG-CMDGGOBGSA-N |
| XLogP | 4.46 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.78 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|