C18H33N — CID 71520468
(5S,7R)-N,N-dimethyl-2,2-dipropyladamantan-1-amine (PubChem CID 71520468) has the molecular formula C18H33N and a molecular weight of 263.47 g/mol. Its IUPAC name is (5S,7R)-N,N-dimethyl-2,2-dipropyladamantan-1-amine.
| Compound Name | (5S,7R)-N,N-dimethyl-2,2-dipropyladamantan-1-amine |
|---|---|
| PubChem CID | 71520468 |
| Molecular Formula | C18H33N |
| Molecular Weight | 263.47 g/mol |
| Exact Mass | 263.26 |
| IUPAC Name | (5S,7R)-N,N-dimethyl-2,2-dipropyladamantan-1-amine |
| SMILES | CCCC1(CCC)C2C[C@@H]3C[C@H](C2)CC1(N(C)C)C3 |
| InChI | InChI=1S/C18H33N/c1-5-7-17(8-6-2)16-10-14-9-15(11-16)13-18(17,12-14)19(3)4/h14-16H,5-13H2,1-4H3/t14-,15+,16?,18? |
| InChIKey | CUBYAAOMDVYTFZ-SFYZZRBRSA-N |
| XLogP | 4.71 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.47 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |