About (5S,7R)-N,N-dimethyl-2-propan-2-yladamantan-1-amine
(5S,7R)-N,N-dimethyl-2-propan-2-yladamantan-1-amine (PubChem CID 71520469) has the molecular formula C15H27N
and a molecular weight of 221.39 g/mol. Its IUPAC name is (5S,7R)-N,N-dimethyl-2-propan-2-yladamantan-1-amine.
Molecular Properties
| Compound Name | (5S,7R)-N,N-dimethyl-2-propan-2-yladamantan-1-amine |
| PubChem CID | 71520469 |
| Molecular Formula | C15H27N |
| Molecular Weight | 221.39 g/mol |
| Exact Mass | 221.21 |
| IUPAC Name | (5S,7R)-N,N-dimethyl-2-propan-2-yladamantan-1-amine |
| SMILES | CC(C)C1C2C[C@@H]3C[C@H](C2)CC1(N(C)C)C3 |
| InChI | InChI=1S/C15H27N/c1-10(2)14-13-6-11-5-12(7-13)9-15(14,8-11)16(3)4/h10-14H,5-9H2,1-4H3/t11-,12+,13?,14?,15? |
| InChIKey | XTXGMPJBMMXLQQ-HONBEQNRSA-N |
| XLogP | 3.40 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.39 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (5S,7R)-N,N-dimethyl-2-propan-2-yladamantan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5S,7R)-N,N-dimethyl-2-propan-2-yladamantan-1-amine?
The IUPAC name of (5S,7R)-N,N-dimethyl-2-propan-2-yladamantan-1-amine (CID 71520469) is (5S,7R)-N,N-dimethyl-2-propan-2-yladamantan-1-amine.
What is the SMILES notation for (5S,7R)-N,N-dimethyl-2-propan-2-yladamantan-1-amine?
The canonical SMILES for (5S,7R)-N,N-dimethyl-2-propan-2-yladamantan-1-amine is CC(C)C1C2C[C@@H]3C[C@H](C2)CC1(N(C)C)C3.
What is the InChIKey of (5S,7R)-N,N-dimethyl-2-propan-2-yladamantan-1-amine?
The InChIKey is XTXGMPJBMMXLQQ-HONBEQNRSA-N. The full InChI is InChI=1S/C15H27N/c1-10(2)14-13-6-11-5-12(7-13)9-15(14,8-11)16(3)4/h10-14H,5-9H2,1-4H3/t11-,12+,13?,14?,15?.
What are the key properties of (5S,7R)-N,N-dimethyl-2-propan-2-yladamantan-1-amine?
(5S,7R)-N,N-dimethyl-2-propan-2-yladamantan-1-amine has a molecular weight of 221.39 g/mol, XLogP of 3.40, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (5S,7R)-N,N-dimethyl-2-propan-2-yladamantan-1-amine is sourced from PubChem (CID 71520469), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).