About N-[6-(hydroxyamino)-6-oxohexoxy]-3,4-dimethylbenzamide
N-[6-(hydroxyamino)-6-oxohexoxy]-3,4-dimethylbenzamide (PubChem CID 71520716) has the molecular formula C15H22N2O4
and a molecular weight of 294.35 g/mol. Its IUPAC name is N-[6-(hydroxyamino)-6-oxohexoxy]-3,4-dimethylbenzamide.
Molecular Properties
| Compound Name | N-[6-(hydroxyamino)-6-oxohexoxy]-3,4-dimethylbenzamide |
| PubChem CID | 71520716 |
| Molecular Formula | C15H22N2O4 |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.16 |
| IUPAC Name | N-[6-(hydroxyamino)-6-oxohexoxy]-3,4-dimethylbenzamide |
| SMILES | Cc1ccc(C(=O)NOCCCCCC(=O)NO)cc1C |
| InChI | InChI=1S/C15H22N2O4/c1-11-7-8-13(10-12(11)2)15(19)17-21-9-5-3-4-6-14(18)16-20/h7-8,10,20H,3-6,9H2,1-2H3,(H,16,18)(H,17,19) |
| InChIKey | XBQPEXDCROFSOE-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-[6-(hydroxyamino)-6-oxohexoxy]-3,4-dimethylbenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[6-(hydroxyamino)-6-oxohexoxy]-3,4-dimethylbenzamide?
The IUPAC name of N-[6-(hydroxyamino)-6-oxohexoxy]-3,4-dimethylbenzamide (CID 71520716) is N-[6-(hydroxyamino)-6-oxohexoxy]-3,4-dimethylbenzamide.
What is the SMILES notation for N-[6-(hydroxyamino)-6-oxohexoxy]-3,4-dimethylbenzamide?
The canonical SMILES for N-[6-(hydroxyamino)-6-oxohexoxy]-3,4-dimethylbenzamide is Cc1ccc(C(=O)NOCCCCCC(=O)NO)cc1C.
What is the InChIKey of N-[6-(hydroxyamino)-6-oxohexoxy]-3,4-dimethylbenzamide?
The InChIKey is XBQPEXDCROFSOE-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H22N2O4/c1-11-7-8-13(10-12(11)2)15(19)17-21-9-5-3-4-6-14(18)16-20/h7-8,10,20H,3-6,9H2,1-2H3,(H,16,18)(H,17,19).
What are the key properties of N-[6-(hydroxyamino)-6-oxohexoxy]-3,4-dimethylbenzamide?
N-[6-(hydroxyamino)-6-oxohexoxy]-3,4-dimethylbenzamide has a molecular weight of 294.35 g/mol, XLogP of 2.03, 8 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[6-(hydroxyamino)-6-oxohexoxy]-3,4-dimethylbenzamide is sourced from PubChem (CID 71520716), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).