C19H20ClN5O2 — CID 71520907
1-[5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]-3-[(E)-(2-methyl-5-prop-1-en-2-ylcyclohex-2-en-1-ylidene)amino]urea (PubChem CID 71520907) has the molecular formula C19H20ClN5O2 and a molecular weight of 385.86 g/mol. Its IUPAC name is 1-[5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]-3-[(E)-(2-methyl-5-prop-1-en-2-ylcyclohex-2-en-1-ylidene)amino]urea.
| Compound Name | 1-[5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]-3-[(E)-(2-methyl-5-prop-1-en-2-ylcyclohex-2-en-1-ylidene)amino]urea |
|---|---|
| PubChem CID | 71520907 |
| Molecular Formula | C19H20ClN5O2 |
| Molecular Weight | 385.86 g/mol |
| Exact Mass | 385.13 |
| IUPAC Name | 1-[5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]-3-[(E)-(2-methyl-5-prop-1-en-2-ylcyclohex-2-en-1-ylidene)amino]urea |
| SMILES | C=C(C)C1CC=C(C)/C(=N/NC(=O)Nc2nnc(-c3ccc(Cl)cc3)o2)C1 |
| InChI | InChI=1S/C19H20ClN5O2/c1-11(2)14-5-4-12(3)16(10-14)22-24-18(26)21-19-25-23-17(27-19)13-6-8-15(20)9-7-13/h4,6-9,14H,1,5,10H2,2-3H3,(H2,21,24,25,26)/b22-16+ |
| InChIKey | HUPAVKNUDHXCCW-CJLVFECKSA-N |
| XLogP | 4.80 |
| TPSA | 92.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.86 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|