C13H16N2O3 — CID 71521229
1-methyl-5-(2,4,6-trimethoxyphenyl)pyrazole (PubChem CID 71521229) has the molecular formula C13H16N2O3 and a molecular weight of 248.28 g/mol. Its IUPAC name is 1-methyl-5-(2,4,6-trimethoxyphenyl)pyrazole.
| Compound Name | 1-methyl-5-(2,4,6-trimethoxyphenyl)pyrazole |
|---|---|
| PubChem CID | 71521229 |
| Molecular Formula | C13H16N2O3 |
| Molecular Weight | 248.28 g/mol |
| Exact Mass | 248.12 |
| IUPAC Name | 1-methyl-5-(2,4,6-trimethoxyphenyl)pyrazole |
| SMILES | COc1cc(OC)c(-c2ccnn2C)c(OC)c1 |
| InChI | InChI=1S/C13H16N2O3/c1-15-10(5-6-14-15)13-11(17-3)7-9(16-2)8-12(13)18-4/h5-8H,1-4H3 |
| InChIKey | AOXDRIGYSZJMDD-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 45.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.28 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |