C18H22F3N5O2 — CID 71521268
N-(2-cyclopropylethyl)-6-[4-[(Z)-4,4,4-trifluorobut-2-enoyl]piperazin-1-yl]pyridazine-3-carboxamide (PubChem CID 71521268) has the molecular formula C18H22F3N5O2 and a molecular weight of 397.40 g/mol. Its IUPAC name is N-(2-cyclopropylethyl)-6-[4-[(Z)-4,4,4-trifluorobut-2-enoyl]piperazin-1-yl]pyridazine-3-carboxamide.
| Compound Name | N-(2-cyclopropylethyl)-6-[4-[(Z)-4,4,4-trifluorobut-2-enoyl]piperazin-1-yl]pyridazine-3-carboxamide |
|---|---|
| PubChem CID | 71521268 |
| Molecular Formula | C18H22F3N5O2 |
| Molecular Weight | 397.40 g/mol |
| Exact Mass | 397.17 |
| IUPAC Name | N-(2-cyclopropylethyl)-6-[4-[(Z)-4,4,4-trifluorobut-2-enoyl]piperazin-1-yl]pyridazine-3-carboxamide |
| SMILES | O=C(NCCC1CC1)c1ccc(N2CCN(C(=O)/C=C\C(F)(F)F)CC2)nn1 |
| InChI | InChI=1S/C18H22F3N5O2/c19-18(20,21)7-5-16(27)26-11-9-25(10-12-26)15-4-3-14(23-24-15)17(28)22-8-6-13-1-2-13/h3-5,7,13H,1-2,6,8-12H2,(H,22,28)/b7-5- |
| InChIKey | XCQKWERVUSCEGP-ALCCZGGFSA-N |
| XLogP | 1.77 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.40 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|