C49H40F6N2O4 — CID 71521523
9H-fluoren-9-ylmethyl 4-[[[3,5-bis(trifluoromethyl)phenyl]methyl-[3-(9H-fluoren-9-ylmethoxycarbonylamino)propyl]amino]methyl]benzoate (PubChem CID 71521523) has the molecular formula C49H40F6N2O4 and a molecular weight of 834.86 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl 4-[[[3,5-bis(trifluoromethyl)phenyl]methyl-[3-(9H-fluoren-9-ylmethoxycarbonylamino)propyl]amino]methyl]benzoate.
| Compound Name | 9H-fluoren-9-ylmethyl 4-[[[3,5-bis(trifluoromethyl)phenyl]methyl-[3-(9H-fluoren-9-ylmethoxycarbonylamino)propyl]amino]methyl]benzoate |
|---|---|
| PubChem CID | 71521523 |
| Molecular Formula | C49H40F6N2O4 |
| Molecular Weight | 834.86 g/mol |
| Exact Mass | 834.29 |
| IUPAC Name | 9H-fluoren-9-ylmethyl 4-[[[3,5-bis(trifluoromethyl)phenyl]methyl-[3-(9H-fluoren-9-ylmethoxycarbonylamino)propyl]amino]methyl]benzoate |
| SMILES | O=C(NCCCN(Cc1ccc(C(=O)OCC2c3ccccc3-c3ccccc32)cc1)Cc1cc(C(F)(F)F)cc(C(F)(F)F)c1)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C49H40F6N2O4/c50-48(51,52)34-24-32(25-35(26-34)49(53,54)55)28-57(23-9-22-56-47(59)61-30-45-42-16-7-3-12-38(42)39-13-4-8-17-43(39)45)27-31-18-20-33(21-19-31)46(58)60-29-44-40-14-5-1-10-36(40)37-11-2-6-15-41(37)44/h1-8,10-21,24-26,44-45H,9,22-23,27-30H2,(H,56,59) |
| InChIKey | TXVXFVXELHAXML-UHFFFAOYSA-N |
| XLogP | 11.62 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 834.86 |
| LogP ≤ 5 | 11.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|