About N-cyclopentyl-5-(phenoxymethyl)-4-phenyl-1,2,4-triazol-3-amine
N-cyclopentyl-5-(phenoxymethyl)-4-phenyl-1,2,4-triazol-3-amine (PubChem CID 71521624) has the molecular formula C20H22N4O
and a molecular weight of 334.42 g/mol. Its IUPAC name is N-cyclopentyl-5-(phenoxymethyl)-4-phenyl-1,2,4-triazol-3-amine.
Molecular Properties
| Compound Name | N-cyclopentyl-5-(phenoxymethyl)-4-phenyl-1,2,4-triazol-3-amine |
| PubChem CID | 71521624 |
| Molecular Formula | C20H22N4O |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.18 |
| IUPAC Name | N-cyclopentyl-5-(phenoxymethyl)-4-phenyl-1,2,4-triazol-3-amine |
| SMILES | c1ccc(OCc2nnc(NC3CCCC3)n2-c2ccccc2)cc1 |
| InChI | InChI=1S/C20H22N4O/c1-3-11-17(12-4-1)24-19(15-25-18-13-5-2-6-14-18)22-23-20(24)21-16-9-7-8-10-16/h1-6,11-14,16H,7-10,15H2,(H,21,23) |
| InChIKey | JBKQYDFMLREVSW-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 51.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-cyclopentyl-5-(phenoxymethyl)-4-phenyl-1,2,4-triazol-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclopentyl-5-(phenoxymethyl)-4-phenyl-1,2,4-triazol-3-amine?
The IUPAC name of N-cyclopentyl-5-(phenoxymethyl)-4-phenyl-1,2,4-triazol-3-amine (CID 71521624) is N-cyclopentyl-5-(phenoxymethyl)-4-phenyl-1,2,4-triazol-3-amine.
What is the SMILES notation for N-cyclopentyl-5-(phenoxymethyl)-4-phenyl-1,2,4-triazol-3-amine?
The canonical SMILES for N-cyclopentyl-5-(phenoxymethyl)-4-phenyl-1,2,4-triazol-3-amine is c1ccc(OCc2nnc(NC3CCCC3)n2-c2ccccc2)cc1.
What is the InChIKey of N-cyclopentyl-5-(phenoxymethyl)-4-phenyl-1,2,4-triazol-3-amine?
The InChIKey is JBKQYDFMLREVSW-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H22N4O/c1-3-11-17(12-4-1)24-19(15-25-18-13-5-2-6-14-18)22-23-20(24)21-16-9-7-8-10-16/h1-6,11-14,16H,7-10,15H2,(H,21,23).
What are the key properties of N-cyclopentyl-5-(phenoxymethyl)-4-phenyl-1,2,4-triazol-3-amine?
N-cyclopentyl-5-(phenoxymethyl)-4-phenyl-1,2,4-triazol-3-amine has a molecular weight of 334.42 g/mol, XLogP of 4.20, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclopentyl-5-(phenoxymethyl)-4-phenyl-1,2,4-triazol-3-amine is sourced from PubChem (CID 71521624), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).