C21H24N4O — CID 71521625
N-cyclohexyl-5-(phenoxymethyl)-4-phenyl-1,2,4-triazol-3-amine (PubChem CID 71521625) has the molecular formula C21H24N4O and a molecular weight of 348.45 g/mol. Its IUPAC name is N-cyclohexyl-5-(phenoxymethyl)-4-phenyl-1,2,4-triazol-3-amine.
| Compound Name | N-cyclohexyl-5-(phenoxymethyl)-4-phenyl-1,2,4-triazol-3-amine |
|---|---|
| PubChem CID | 71521625 |
| Molecular Formula | C21H24N4O |
| Molecular Weight | 348.45 g/mol |
| Exact Mass | 348.20 |
| IUPAC Name | N-cyclohexyl-5-(phenoxymethyl)-4-phenyl-1,2,4-triazol-3-amine |
| SMILES | c1ccc(OCc2nnc(NC3CCCCC3)n2-c2ccccc2)cc1 |
| InChI | InChI=1S/C21H24N4O/c1-4-10-17(11-5-1)22-21-24-23-20(16-26-19-14-8-3-9-15-19)25(21)18-12-6-2-7-13-18/h2-3,6-9,12-15,17H,1,4-5,10-11,16H2,(H,22,24) |
| InChIKey | OJMHAUHMKOBVRO-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 51.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.45 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |