C16H19ClN8O3S — CID 71521835
(2S,3S,4R,5R)-2-(6-aminopurin-9-yl)-5-[2-[(4-chloropyrimidin-2-yl)amino]ethylsulfanylmethyl]oxolane-3,4-diol (PubChem CID 71521835) has the molecular formula C16H19ClN8O3S and a molecular weight of 438.90 g/mol. Its IUPAC name is (2S,3S,4R,5R)-2-(6-aminopurin-9-yl)-5-[2-[(4-chloropyrimidin-2-yl)amino]ethylsulfanylmethyl]oxolane-3,4-diol.
| Compound Name | (2S,3S,4R,5R)-2-(6-aminopurin-9-yl)-5-[2-[(4-chloropyrimidin-2-yl)amino]ethylsulfanylmethyl]oxolane-3,4-diol |
|---|---|
| PubChem CID | 71521835 |
| Molecular Formula | C16H19ClN8O3S |
| Molecular Weight | 438.90 g/mol |
| Exact Mass | 438.10 |
| IUPAC Name | (2S,3S,4R,5R)-2-(6-aminopurin-9-yl)-5-[2-[(4-chloropyrimidin-2-yl)amino]ethylsulfanylmethyl]oxolane-3,4-diol |
| SMILES | Nc1ncnc2c1ncn2[C@H]1O[C@@H](CSCCNc2nccc(Cl)n2)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C16H19ClN8O3S/c17-9-1-2-19-16(24-9)20-3-4-29-5-8-11(26)12(27)15(28-8)25-7-23-10-13(18)21-6-22-14(10)25/h1-2,6-8,11-12,15,26-27H,3-5H2,(H2,18,21,22)(H,19,20,24)/t8-,11-,12-,15-/m0/s1 |
| InChIKey | ZWBSJRQJKXXDKA-REXDEQPNSA-N |
| XLogP | 0.32 |
| TPSA | 157.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.90 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|