About 3-(4-chloro-1,3-benzothiazol-2-yl)-2-(2-chloro-6-fluorophenyl)-1,3-thiazolidin-4-one
3-(4-chloro-1,3-benzothiazol-2-yl)-2-(2-chloro-6-fluorophenyl)-1,3-thiazolidin-4-one (PubChem CID 71521914) has the molecular formula C16H9Cl2FN2OS2
and a molecular weight of 399.30 g/mol. Its IUPAC name is 3-(4-chloro-1,3-benzothiazol-2-yl)-2-(2-chloro-6-fluorophenyl)-1,3-thiazolidin-4-one.
Molecular Properties
| Compound Name | 3-(4-chloro-1,3-benzothiazol-2-yl)-2-(2-chloro-6-fluorophenyl)-1,3-thiazolidin-4-one |
| PubChem CID | 71521914 |
| Molecular Formula | C16H9Cl2FN2OS2 |
| Molecular Weight | 399.30 g/mol |
| Exact Mass | 397.95 |
| IUPAC Name | 3-(4-chloro-1,3-benzothiazol-2-yl)-2-(2-chloro-6-fluorophenyl)-1,3-thiazolidin-4-one |
| SMILES | O=C1CSC(c2c(F)cccc2Cl)N1c1nc2c(Cl)cccc2s1 |
| InChI | InChI=1S/C16H9Cl2FN2OS2/c17-8-3-1-5-10(19)13(8)15-21(12(22)7-23-15)16-20-14-9(18)4-2-6-11(14)24-16/h1-6,15H,7H2 |
| InChIKey | WZTJGVWOJDMCHT-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 399.30 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-(4-chloro-1,3-benzothiazol-2-yl)-2-(2-chloro-6-fluorophenyl)-1,3-thiazolidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-chloro-1,3-benzothiazol-2-yl)-2-(2-chloro-6-fluorophenyl)-1,3-thiazolidin-4-one?
The IUPAC name of 3-(4-chloro-1,3-benzothiazol-2-yl)-2-(2-chloro-6-fluorophenyl)-1,3-thiazolidin-4-one (CID 71521914) is 3-(4-chloro-1,3-benzothiazol-2-yl)-2-(2-chloro-6-fluorophenyl)-1,3-thiazolidin-4-one.
What is the SMILES notation for 3-(4-chloro-1,3-benzothiazol-2-yl)-2-(2-chloro-6-fluorophenyl)-1,3-thiazolidin-4-one?
The canonical SMILES for 3-(4-chloro-1,3-benzothiazol-2-yl)-2-(2-chloro-6-fluorophenyl)-1,3-thiazolidin-4-one is O=C1CSC(c2c(F)cccc2Cl)N1c1nc2c(Cl)cccc2s1.
What is the InChIKey of 3-(4-chloro-1,3-benzothiazol-2-yl)-2-(2-chloro-6-fluorophenyl)-1,3-thiazolidin-4-one?
The InChIKey is WZTJGVWOJDMCHT-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H9Cl2FN2OS2/c17-8-3-1-5-10(19)13(8)15-21(12(22)7-23-15)16-20-14-9(18)4-2-6-11(14)24-16/h1-6,15H,7H2.
What are the key properties of 3-(4-chloro-1,3-benzothiazol-2-yl)-2-(2-chloro-6-fluorophenyl)-1,3-thiazolidin-4-one?
3-(4-chloro-1,3-benzothiazol-2-yl)-2-(2-chloro-6-fluorophenyl)-1,3-thiazolidin-4-one has a molecular weight of 399.30 g/mol, XLogP of 5.52, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-chloro-1,3-benzothiazol-2-yl)-2-(2-chloro-6-fluorophenyl)-1,3-thiazolidin-4-one is sourced from PubChem (CID 71521914), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).