C25H23FN6O6S — CID 71522194
1-ethyl-6-fluoro-7-[4-[2-[(6-nitro-1,3-benzothiazol-2-yl)amino]-2-oxoethyl]piperazin-1-yl]-4-oxoquinoline-3-carboxylic acid (PubChem CID 71522194) has the molecular formula C25H23FN6O6S and a molecular weight of 554.56 g/mol. Its IUPAC name is 1-ethyl-6-fluoro-7-[4-[2-[(6-nitro-1,3-benzothiazol-2-yl)amino]-2-oxoethyl]piperazin-1-yl]-4-oxoquinoline-3-carboxylic acid.
| Compound Name | 1-ethyl-6-fluoro-7-[4-[2-[(6-nitro-1,3-benzothiazol-2-yl)amino]-2-oxoethyl]piperazin-1-yl]-4-oxoquinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 71522194 |
| Molecular Formula | C25H23FN6O6S |
| Molecular Weight | 554.56 g/mol |
| Exact Mass | 554.14 |
| IUPAC Name | 1-ethyl-6-fluoro-7-[4-[2-[(6-nitro-1,3-benzothiazol-2-yl)amino]-2-oxoethyl]piperazin-1-yl]-4-oxoquinoline-3-carboxylic acid |
| SMILES | CCn1cc(C(=O)O)c(=O)c2cc(F)c(N3CCN(CC(=O)Nc4nc5ccc([N+](=O)[O-])cc5s4)CC3)cc21 |
| InChI | InChI=1S/C25H23FN6O6S/c1-2-30-12-16(24(35)36)23(34)15-10-17(26)20(11-19(15)30)31-7-5-29(6-8-31)13-22(33)28-25-27-18-4-3-14(32(37)38)9-21(18)39-25/h3-4,9-12H,2,5-8,13H2,1H3,(H,35,36)(H,27,28,33) |
| InChIKey | IDQFNZLNXUEMRT-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 150.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.56 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|