About (S)-[(1S,2S)-2-aminocyclopentyl]-[1-(4-chlorophenyl)cyclobutyl]methanol
(S)-[(1S,2S)-2-aminocyclopentyl]-[1-(4-chlorophenyl)cyclobutyl]methanol (PubChem CID 71522267) has the molecular formula C16H22ClNO
and a molecular weight of 279.81 g/mol. Its IUPAC name is (S)-[(1S,2S)-2-aminocyclopentyl]-[1-(4-chlorophenyl)cyclobutyl]methanol.
Molecular Properties
| Compound Name | (S)-[(1S,2S)-2-aminocyclopentyl]-[1-(4-chlorophenyl)cyclobutyl]methanol |
| PubChem CID | 71522267 |
| Molecular Formula | C16H22ClNO |
| Molecular Weight | 279.81 g/mol |
| Exact Mass | 279.14 |
| IUPAC Name | (S)-[(1S,2S)-2-aminocyclopentyl]-[1-(4-chlorophenyl)cyclobutyl]methanol |
| SMILES | N[C@H]1CCC[C@@H]1[C@H](O)C1(c2ccc(Cl)cc2)CCC1 |
| InChI | InChI=1S/C16H22ClNO/c17-12-7-5-11(6-8-12)16(9-2-10-16)15(19)13-3-1-4-14(13)18/h5-8,13-15,19H,1-4,9-10,18H2/t13-,14-,15-/m0/s1 |
| InChIKey | NDWSGCOLESQGKR-KKUMJFAQSA-N |
| XLogP | 3.25 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.81 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (S)-[(1S,2S)-2-aminocyclopentyl]-[1-(4-chlorophenyl)cyclobutyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (S)-[(1S,2S)-2-aminocyclopentyl]-[1-(4-chlorophenyl)cyclobutyl]methanol?
The IUPAC name of (S)-[(1S,2S)-2-aminocyclopentyl]-[1-(4-chlorophenyl)cyclobutyl]methanol (CID 71522267) is (S)-[(1S,2S)-2-aminocyclopentyl]-[1-(4-chlorophenyl)cyclobutyl]methanol.
What is the SMILES notation for (S)-[(1S,2S)-2-aminocyclopentyl]-[1-(4-chlorophenyl)cyclobutyl]methanol?
The canonical SMILES for (S)-[(1S,2S)-2-aminocyclopentyl]-[1-(4-chlorophenyl)cyclobutyl]methanol is N[C@H]1CCC[C@@H]1[C@H](O)C1(c2ccc(Cl)cc2)CCC1.
What is the InChIKey of (S)-[(1S,2S)-2-aminocyclopentyl]-[1-(4-chlorophenyl)cyclobutyl]methanol?
The InChIKey is NDWSGCOLESQGKR-KKUMJFAQSA-N. The full InChI is InChI=1S/C16H22ClNO/c17-12-7-5-11(6-8-12)16(9-2-10-16)15(19)13-3-1-4-14(13)18/h5-8,13-15,19H,1-4,9-10,18H2/t13-,14-,15-/m0/s1.
What are the key properties of (S)-[(1S,2S)-2-aminocyclopentyl]-[1-(4-chlorophenyl)cyclobutyl]methanol?
(S)-[(1S,2S)-2-aminocyclopentyl]-[1-(4-chlorophenyl)cyclobutyl]methanol has a molecular weight of 279.81 g/mol, XLogP of 3.25, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (S)-[(1S,2S)-2-aminocyclopentyl]-[1-(4-chlorophenyl)cyclobutyl]methanol is sourced from PubChem (CID 71522267), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).