C19H22F5N3O2 — CID 71522454
2-[2,6-difluoro-4-[3-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]propoxy]phenyl]-5-methyl-1,3,4-oxadiazole (PubChem CID 71522454) has the molecular formula C19H22F5N3O2 and a molecular weight of 419.39 g/mol. Its IUPAC name is 2-[2,6-difluoro-4-[3-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]propoxy]phenyl]-5-methyl-1,3,4-oxadiazole.
| Compound Name | 2-[2,6-difluoro-4-[3-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]propoxy]phenyl]-5-methyl-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 71522454 |
| Molecular Formula | C19H22F5N3O2 |
| Molecular Weight | 419.39 g/mol |
| Exact Mass | 419.16 |
| IUPAC Name | 2-[2,6-difluoro-4-[3-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]propoxy]phenyl]-5-methyl-1,3,4-oxadiazole |
| SMILES | Cc1nnc(-c2c(F)cc(OCCCC3CCN(CC(F)(F)F)CC3)cc2F)o1 |
| InChI | InChI=1S/C19H22F5N3O2/c1-12-25-26-18(29-12)17-15(20)9-14(10-16(17)21)28-8-2-3-13-4-6-27(7-5-13)11-19(22,23)24/h9-10,13H,2-8,11H2,1H3 |
| InChIKey | KUBXNSAFAFGFIT-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 51.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.39 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|