About (R)-[(2S)-2-(3,4-dichlorophenyl)oxetan-2-yl]-pyridin-2-ylmethanol
(R)-[(2S)-2-(3,4-dichlorophenyl)oxetan-2-yl]-pyridin-2-ylmethanol (PubChem CID 71522470) has the molecular formula C15H13Cl2NO2
and a molecular weight of 310.18 g/mol. Its IUPAC name is (R)-[(2S)-2-(3,4-dichlorophenyl)oxetan-2-yl]-pyridin-2-ylmethanol.
Molecular Properties
| Compound Name | (R)-[(2S)-2-(3,4-dichlorophenyl)oxetan-2-yl]-pyridin-2-ylmethanol |
| PubChem CID | 71522470 |
| Molecular Formula | C15H13Cl2NO2 |
| Molecular Weight | 310.18 g/mol |
| Exact Mass | 309.03 |
| IUPAC Name | (R)-[(2S)-2-(3,4-dichlorophenyl)oxetan-2-yl]-pyridin-2-ylmethanol |
| SMILES | O[C@H](c1ccccn1)[C@@]1(c2ccc(Cl)c(Cl)c2)CCO1 |
| InChI | InChI=1S/C15H13Cl2NO2/c16-11-5-4-10(9-12(11)17)15(6-8-20-15)14(19)13-3-1-2-7-18-13/h1-5,7,9,14,19H,6,8H2/t14-,15+/m1/s1 |
| InChIKey | ALNGBZZADVDQDE-CABCVRRESA-N |
| XLogP | 3.74 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.18 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (R)-[(2S)-2-(3,4-dichlorophenyl)oxetan-2-yl]-pyridin-2-ylmethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (R)-[(2S)-2-(3,4-dichlorophenyl)oxetan-2-yl]-pyridin-2-ylmethanol?
The IUPAC name of (R)-[(2S)-2-(3,4-dichlorophenyl)oxetan-2-yl]-pyridin-2-ylmethanol (CID 71522470) is (R)-[(2S)-2-(3,4-dichlorophenyl)oxetan-2-yl]-pyridin-2-ylmethanol.
What is the SMILES notation for (R)-[(2S)-2-(3,4-dichlorophenyl)oxetan-2-yl]-pyridin-2-ylmethanol?
The canonical SMILES for (R)-[(2S)-2-(3,4-dichlorophenyl)oxetan-2-yl]-pyridin-2-ylmethanol is O[C@H](c1ccccn1)[C@@]1(c2ccc(Cl)c(Cl)c2)CCO1.
What is the InChIKey of (R)-[(2S)-2-(3,4-dichlorophenyl)oxetan-2-yl]-pyridin-2-ylmethanol?
The InChIKey is ALNGBZZADVDQDE-CABCVRRESA-N. The full InChI is InChI=1S/C15H13Cl2NO2/c16-11-5-4-10(9-12(11)17)15(6-8-20-15)14(19)13-3-1-2-7-18-13/h1-5,7,9,14,19H,6,8H2/t14-,15+/m1/s1.
What are the key properties of (R)-[(2S)-2-(3,4-dichlorophenyl)oxetan-2-yl]-pyridin-2-ylmethanol?
(R)-[(2S)-2-(3,4-dichlorophenyl)oxetan-2-yl]-pyridin-2-ylmethanol has a molecular weight of 310.18 g/mol, XLogP of 3.74, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (R)-[(2S)-2-(3,4-dichlorophenyl)oxetan-2-yl]-pyridin-2-ylmethanol is sourced from PubChem (CID 71522470), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).