About N-[(1R,2S)-2-(4-bromophenyl)cyclopropyl]-1,1-dioxothian-4-amine
N-[(1R,2S)-2-(4-bromophenyl)cyclopropyl]-1,1-dioxothian-4-amine (PubChem CID 71522622) has the molecular formula C14H18BrNO2S
and a molecular weight of 344.27 g/mol. Its IUPAC name is N-[(1R,2S)-2-(4-bromophenyl)cyclopropyl]-1,1-dioxothian-4-amine.
Molecular Properties
| Compound Name | N-[(1R,2S)-2-(4-bromophenyl)cyclopropyl]-1,1-dioxothian-4-amine |
| PubChem CID | 71522622 |
| Molecular Formula | C14H18BrNO2S |
| Molecular Weight | 344.27 g/mol |
| Exact Mass | 343.02 |
| IUPAC Name | N-[(1R,2S)-2-(4-bromophenyl)cyclopropyl]-1,1-dioxothian-4-amine |
| SMILES | O=S1(=O)CCC(N[C@@H]2C[C@H]2c2ccc(Br)cc2)CC1 |
| InChI | InChI=1S/C14H18BrNO2S/c15-11-3-1-10(2-4-11)13-9-14(13)16-12-5-7-19(17,18)8-6-12/h1-4,12-14,16H,5-9H2/t13-,14+/m0/s1 |
| InChIKey | BVPJDKNHUWDWDV-UONOGXRCSA-N |
| XLogP | 2.47 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.27 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[(1R,2S)-2-(4-bromophenyl)cyclopropyl]-1,1-dioxothian-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(1R,2S)-2-(4-bromophenyl)cyclopropyl]-1,1-dioxothian-4-amine?
The IUPAC name of N-[(1R,2S)-2-(4-bromophenyl)cyclopropyl]-1,1-dioxothian-4-amine (CID 71522622) is N-[(1R,2S)-2-(4-bromophenyl)cyclopropyl]-1,1-dioxothian-4-amine.
What is the SMILES notation for N-[(1R,2S)-2-(4-bromophenyl)cyclopropyl]-1,1-dioxothian-4-amine?
The canonical SMILES for N-[(1R,2S)-2-(4-bromophenyl)cyclopropyl]-1,1-dioxothian-4-amine is O=S1(=O)CCC(N[C@@H]2C[C@H]2c2ccc(Br)cc2)CC1.
What is the InChIKey of N-[(1R,2S)-2-(4-bromophenyl)cyclopropyl]-1,1-dioxothian-4-amine?
The InChIKey is BVPJDKNHUWDWDV-UONOGXRCSA-N. The full InChI is InChI=1S/C14H18BrNO2S/c15-11-3-1-10(2-4-11)13-9-14(13)16-12-5-7-19(17,18)8-6-12/h1-4,12-14,16H,5-9H2/t13-,14+/m0/s1.
What are the key properties of N-[(1R,2S)-2-(4-bromophenyl)cyclopropyl]-1,1-dioxothian-4-amine?
N-[(1R,2S)-2-(4-bromophenyl)cyclopropyl]-1,1-dioxothian-4-amine has a molecular weight of 344.27 g/mol, XLogP of 2.47, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(1R,2S)-2-(4-bromophenyl)cyclopropyl]-1,1-dioxothian-4-amine is sourced from PubChem (CID 71522622), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).