About [4-[2,6-bis[(3R)-3-methylmorpholin-4-yl]-7H-purin-8-yl]-1H-indol-6-yl]methanol
[4-[2,6-bis[(3R)-3-methylmorpholin-4-yl]-7H-purin-8-yl]-1H-indol-6-yl]methanol (PubChem CID 71522969) has the molecular formula C24H29N7O3
and a molecular weight of 463.54 g/mol. Its IUPAC name is [4-[2,6-bis[(3R)-3-methylmorpholin-4-yl]-7H-purin-8-yl]-1H-indol-6-yl]methanol.
Molecular Properties
| Compound Name | [4-[2,6-bis[(3R)-3-methylmorpholin-4-yl]-7H-purin-8-yl]-1H-indol-6-yl]methanol |
| PubChem CID | 71522969 |
| Molecular Formula | C24H29N7O3 |
| Molecular Weight | 463.54 g/mol |
| Exact Mass | 463.23 |
| IUPAC Name | [4-[2,6-bis[(3R)-3-methylmorpholin-4-yl]-7H-purin-8-yl]-1H-indol-6-yl]methanol |
| SMILES | C[C@@H]1COCCN1c1nc(N2CCOC[C@H]2C)c2[nH]c(-c3cc(CO)cc4[nH]ccc34)nc2n1 |
| InChI | InChI=1S/C24H29N7O3/c1-14-12-33-7-5-30(14)23-20-22(28-24(29-23)31-6-8-34-13-15(31)2)27-21(26-20)18-9-16(11-32)10-19-17(18)3-4-25-19/h3-4,9-10,14-15,25,32H,5-8,11-13H2,1-2H3,(H,26,27,28,29)/t14-,15-/m1/s1 |
| InChIKey | WYYXLVJZNVDSHH-HUUCEWRRSA-N |
| XLogP | 2.44 |
| TPSA | 115.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 463.54 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze [4-[2,6-bis[(3R)-3-methylmorpholin-4-yl]-7H-purin-8-yl]-1H-indol-6-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[2,6-bis[(3R)-3-methylmorpholin-4-yl]-7H-purin-8-yl]-1H-indol-6-yl]methanol?
The IUPAC name of [4-[2,6-bis[(3R)-3-methylmorpholin-4-yl]-7H-purin-8-yl]-1H-indol-6-yl]methanol (CID 71522969) is [4-[2,6-bis[(3R)-3-methylmorpholin-4-yl]-7H-purin-8-yl]-1H-indol-6-yl]methanol.
What is the SMILES notation for [4-[2,6-bis[(3R)-3-methylmorpholin-4-yl]-7H-purin-8-yl]-1H-indol-6-yl]methanol?
The canonical SMILES for [4-[2,6-bis[(3R)-3-methylmorpholin-4-yl]-7H-purin-8-yl]-1H-indol-6-yl]methanol is C[C@@H]1COCCN1c1nc(N2CCOC[C@H]2C)c2[nH]c(-c3cc(CO)cc4[nH]ccc34)nc2n1.
What is the InChIKey of [4-[2,6-bis[(3R)-3-methylmorpholin-4-yl]-7H-purin-8-yl]-1H-indol-6-yl]methanol?
The InChIKey is WYYXLVJZNVDSHH-HUUCEWRRSA-N. The full InChI is InChI=1S/C24H29N7O3/c1-14-12-33-7-5-30(14)23-20-22(28-24(29-23)31-6-8-34-13-15(31)2)27-21(26-20)18-9-16(11-32)10-19-17(18)3-4-25-19/h3-4,9-10,14-15,25,32H,5-8,11-13H2,1-2H3,(H,26,27,28,29)/t14-,15-/m1/s1.
What are the key properties of [4-[2,6-bis[(3R)-3-methylmorpholin-4-yl]-7H-purin-8-yl]-1H-indol-6-yl]methanol?
[4-[2,6-bis[(3R)-3-methylmorpholin-4-yl]-7H-purin-8-yl]-1H-indol-6-yl]methanol has a molecular weight of 463.54 g/mol, XLogP of 2.44, 4 rotatable bonds, 3 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[2,6-bis[(3R)-3-methylmorpholin-4-yl]-7H-purin-8-yl]-1H-indol-6-yl]methanol is sourced from PubChem (CID 71522969), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).