C25H29N7O2 — CID 71523137
5-[8-(1H-indol-4-yl)-6-[(3R)-3-methylmorpholin-4-yl]-7H-purin-2-yl]-3,3a,4,6,7,7a-hexahydro-1H-furo[3,4-c]pyridine (PubChem CID 71523137) has the molecular formula C25H29N7O2 and a molecular weight of 459.55 g/mol. Its IUPAC name is 5-[8-(1H-indol-4-yl)-6-[(3R)-3-methylmorpholin-4-yl]-7H-purin-2-yl]-3,3a,4,6,7,7a-hexahydro-1H-furo[3,4-c]pyridine.
| Compound Name | 5-[8-(1H-indol-4-yl)-6-[(3R)-3-methylmorpholin-4-yl]-7H-purin-2-yl]-3,3a,4,6,7,7a-hexahydro-1H-furo[3,4-c]pyridine |
|---|---|
| PubChem CID | 71523137 |
| Molecular Formula | C25H29N7O2 |
| Molecular Weight | 459.55 g/mol |
| Exact Mass | 459.24 |
| IUPAC Name | 5-[8-(1H-indol-4-yl)-6-[(3R)-3-methylmorpholin-4-yl]-7H-purin-2-yl]-3,3a,4,6,7,7a-hexahydro-1H-furo[3,4-c]pyridine |
| SMILES | C[C@@H]1COCCN1c1nc(N2CCC3COCC3C2)nc2nc(-c3cccc4[nH]ccc34)[nH]c12 |
| InChI | InChI=1S/C25H29N7O2/c1-15-12-33-10-9-32(15)24-21-23(28-22(27-21)19-3-2-4-20-18(19)5-7-26-20)29-25(30-24)31-8-6-16-13-34-14-17(16)11-31/h2-5,7,15-17,26H,6,8-14H2,1H3,(H,27,28,29,30)/t15-,16?,17?/m1/s1 |
| InChIKey | ZMPIPOHWMDLLKV-KLAILNCOSA-N |
| XLogP | 3.20 |
| TPSA | 95.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.55 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |