About 5-[2,6-bis[(3S)-3-methylmorpholin-4-yl]-7H-purin-8-yl]pyridin-2-amine
5-[2,6-bis[(3S)-3-methylmorpholin-4-yl]-7H-purin-8-yl]pyridin-2-amine (PubChem CID 71523317) has the molecular formula C20H26N8O2
and a molecular weight of 410.48 g/mol. Its IUPAC name is 5-[2,6-bis[(3S)-3-methylmorpholin-4-yl]-7H-purin-8-yl]pyridin-2-amine.
Molecular Properties
| Compound Name | 5-[2,6-bis[(3S)-3-methylmorpholin-4-yl]-7H-purin-8-yl]pyridin-2-amine |
| PubChem CID | 71523317 |
| Molecular Formula | C20H26N8O2 |
| Molecular Weight | 410.48 g/mol |
| Exact Mass | 410.22 |
| IUPAC Name | 5-[2,6-bis[(3S)-3-methylmorpholin-4-yl]-7H-purin-8-yl]pyridin-2-amine |
| SMILES | C[C@H]1COCCN1c1nc(N2CCOC[C@@H]2C)c2[nH]c(-c3ccc(N)nc3)nc2n1 |
| InChI | InChI=1S/C20H26N8O2/c1-12-10-29-7-5-27(12)19-16-18(24-17(23-16)14-3-4-15(21)22-9-14)25-20(26-19)28-6-8-30-11-13(28)2/h3-4,9,12-13H,5-8,10-11H2,1-2H3,(H2,21,22)(H,23,24,25,26)/t12-,13-/m0/s1 |
| InChIKey | UPCZFZITQYXIIG-STQMWFEESA-N |
| XLogP | 1.45 |
| TPSA | 118.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 410.48 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
Analyze 5-[2,6-bis[(3S)-3-methylmorpholin-4-yl]-7H-purin-8-yl]pyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[2,6-bis[(3S)-3-methylmorpholin-4-yl]-7H-purin-8-yl]pyridin-2-amine?
The IUPAC name of 5-[2,6-bis[(3S)-3-methylmorpholin-4-yl]-7H-purin-8-yl]pyridin-2-amine (CID 71523317) is 5-[2,6-bis[(3S)-3-methylmorpholin-4-yl]-7H-purin-8-yl]pyridin-2-amine.
What is the SMILES notation for 5-[2,6-bis[(3S)-3-methylmorpholin-4-yl]-7H-purin-8-yl]pyridin-2-amine?
The canonical SMILES for 5-[2,6-bis[(3S)-3-methylmorpholin-4-yl]-7H-purin-8-yl]pyridin-2-amine is C[C@H]1COCCN1c1nc(N2CCOC[C@@H]2C)c2[nH]c(-c3ccc(N)nc3)nc2n1.
What is the InChIKey of 5-[2,6-bis[(3S)-3-methylmorpholin-4-yl]-7H-purin-8-yl]pyridin-2-amine?
The InChIKey is UPCZFZITQYXIIG-STQMWFEESA-N. The full InChI is InChI=1S/C20H26N8O2/c1-12-10-29-7-5-27(12)19-16-18(24-17(23-16)14-3-4-15(21)22-9-14)25-20(26-19)28-6-8-30-11-13(28)2/h3-4,9,12-13H,5-8,10-11H2,1-2H3,(H2,21,22)(H,23,24,25,26)/t12-,13-/m0/s1.
What are the key properties of 5-[2,6-bis[(3S)-3-methylmorpholin-4-yl]-7H-purin-8-yl]pyridin-2-amine?
5-[2,6-bis[(3S)-3-methylmorpholin-4-yl]-7H-purin-8-yl]pyridin-2-amine has a molecular weight of 410.48 g/mol, XLogP of 1.45, 3 rotatable bonds, 2 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[2,6-bis[(3S)-3-methylmorpholin-4-yl]-7H-purin-8-yl]pyridin-2-amine is sourced from PubChem (CID 71523317), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).