About methyl 4-[2,6-bis[(3R)-3-methylmorpholin-4-yl]-7H-purin-8-yl]-1H-indole-6-carboxylate
methyl 4-[2,6-bis[(3R)-3-methylmorpholin-4-yl]-7H-purin-8-yl]-1H-indole-6-carboxylate (PubChem CID 71523321) has the molecular formula C25H29N7O4
and a molecular weight of 491.55 g/mol. Its IUPAC name is methyl 4-[2,6-bis[(3R)-3-methylmorpholin-4-yl]-7H-purin-8-yl]-1H-indole-6-carboxylate.
Molecular Properties
| Compound Name | methyl 4-[2,6-bis[(3R)-3-methylmorpholin-4-yl]-7H-purin-8-yl]-1H-indole-6-carboxylate |
| PubChem CID | 71523321 |
| Molecular Formula | C25H29N7O4 |
| Molecular Weight | 491.55 g/mol |
| Exact Mass | 491.23 |
| IUPAC Name | methyl 4-[2,6-bis[(3R)-3-methylmorpholin-4-yl]-7H-purin-8-yl]-1H-indole-6-carboxylate |
| SMILES | COC(=O)c1cc(-c2nc3nc(N4CCOC[C@H]4C)nc(N4CCOC[C@H]4C)c3[nH]2)c2cc[nH]c2c1 |
| InChI | InChI=1S/C25H29N7O4/c1-14-12-35-8-6-31(14)23-20-22(29-25(30-23)32-7-9-36-13-15(32)2)28-21(27-20)18-10-16(24(33)34-3)11-19-17(18)4-5-26-19/h4-5,10-11,14-15,26H,6-9,12-13H2,1-3H3,(H,27,28,29,30)/t14-,15-/m1/s1 |
| InChIKey | XQPCBPVDGMZKJI-HUUCEWRRSA-N |
| XLogP | 2.74 |
| TPSA | 121.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 491.55 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
Analyze methyl 4-[2,6-bis[(3R)-3-methylmorpholin-4-yl]-7H-purin-8-yl]-1H-indole-6-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-[2,6-bis[(3R)-3-methylmorpholin-4-yl]-7H-purin-8-yl]-1H-indole-6-carboxylate?
The IUPAC name of methyl 4-[2,6-bis[(3R)-3-methylmorpholin-4-yl]-7H-purin-8-yl]-1H-indole-6-carboxylate (CID 71523321) is methyl 4-[2,6-bis[(3R)-3-methylmorpholin-4-yl]-7H-purin-8-yl]-1H-indole-6-carboxylate.
What is the SMILES notation for methyl 4-[2,6-bis[(3R)-3-methylmorpholin-4-yl]-7H-purin-8-yl]-1H-indole-6-carboxylate?
The canonical SMILES for methyl 4-[2,6-bis[(3R)-3-methylmorpholin-4-yl]-7H-purin-8-yl]-1H-indole-6-carboxylate is COC(=O)c1cc(-c2nc3nc(N4CCOC[C@H]4C)nc(N4CCOC[C@H]4C)c3[nH]2)c2cc[nH]c2c1.
What is the InChIKey of methyl 4-[2,6-bis[(3R)-3-methylmorpholin-4-yl]-7H-purin-8-yl]-1H-indole-6-carboxylate?
The InChIKey is XQPCBPVDGMZKJI-HUUCEWRRSA-N. The full InChI is InChI=1S/C25H29N7O4/c1-14-12-35-8-6-31(14)23-20-22(29-25(30-23)32-7-9-36-13-15(32)2)28-21(27-20)18-10-16(24(33)34-3)11-19-17(18)4-5-26-19/h4-5,10-11,14-15,26H,6-9,12-13H2,1-3H3,(H,27,28,29,30)/t14-,15-/m1/s1.
What are the key properties of methyl 4-[2,6-bis[(3R)-3-methylmorpholin-4-yl]-7H-purin-8-yl]-1H-indole-6-carboxylate?
methyl 4-[2,6-bis[(3R)-3-methylmorpholin-4-yl]-7H-purin-8-yl]-1H-indole-6-carboxylate has a molecular weight of 491.55 g/mol, XLogP of 2.74, 4 rotatable bonds, 2 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-[2,6-bis[(3R)-3-methylmorpholin-4-yl]-7H-purin-8-yl]-1H-indole-6-carboxylate is sourced from PubChem (CID 71523321), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).