C30H42O7 — CID 71523420
[(4S,5S,6R,9S,12R,14R)-7-(acetyloxymethyl)-5,6-dihydroxy-3,11,11,14-tetramethyl-15-oxo-4-tetracyclo[7.5.1.01,5.010,12]pentadeca-2,7-dienyl] 2-methylideneheptanoate (PubChem CID 71523420) has the molecular formula C30H42O7 and a molecular weight of 514.66 g/mol. Its IUPAC name is [(4S,5S,6R,9S,12R,14R)-7-(acetyloxymethyl)-5,6-dihydroxy-3,11,11,14-tetramethyl-15-oxo-4-tetracyclo[7.5.1.01,5.010,12]pentadeca-2,7-dienyl] 2-methylideneheptanoate.
| Compound Name | [(4S,5S,6R,9S,12R,14R)-7-(acetyloxymethyl)-5,6-dihydroxy-3,11,11,14-tetramethyl-15-oxo-4-tetracyclo[7.5.1.01,5.010,12]pentadeca-2,7-dienyl] 2-methylideneheptanoate |
|---|---|
| PubChem CID | 71523420 |
| Molecular Formula | C30H42O7 |
| Molecular Weight | 514.66 g/mol |
| Exact Mass | 514.29 |
| IUPAC Name | [(4S,5S,6R,9S,12R,14R)-7-(acetyloxymethyl)-5,6-dihydroxy-3,11,11,14-tetramethyl-15-oxo-4-tetracyclo[7.5.1.01,5.010,12]pentadeca-2,7-dienyl] 2-methylideneheptanoate |
| SMILES | C=C(CCCCC)C(=O)O[C@H]1C(C)=CC23C(=O)[C@@H](C=C(COC(C)=O)[C@@H](O)[C@]12O)C1[C@@H](C[C@H]3C)C1(C)C |
| InChI | InChI=1S/C30H42O7/c1-8-9-10-11-16(2)27(34)37-26-17(3)14-29-18(4)12-22-23(28(22,6)7)21(25(29)33)13-20(15-36-19(5)31)24(32)30(26,29)35/h13-14,18,21-24,26,32,35H,2,8-12,15H2,1,3-7H3/t18-,21+,22-,23?,24-,26+,29?,30+/m1/s1 |
| InChIKey | MMJFJZTWCUDGBJ-UBWMPHGQSA-N |
| XLogP | 4.07 |
| TPSA | 110.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.66 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|