C18H24N4OS — CID 7152368
(2S)-2-(1-amino-4-phenylimidazol-2-yl)sulfanyl-N-cyclohexylpropanamide (PubChem CID 7152368) has the molecular formula C18H24N4OS and a molecular weight of 344.48 g/mol. Its IUPAC name is (2S)-2-(1-amino-4-phenylimidazol-2-yl)sulfanyl-N-cyclohexylpropanamide.
| Compound Name | (2S)-2-(1-amino-4-phenylimidazol-2-yl)sulfanyl-N-cyclohexylpropanamide |
|---|---|
| PubChem CID | 7152368 |
| Molecular Formula | C18H24N4OS |
| Molecular Weight | 344.48 g/mol |
| Exact Mass | 344.17 |
| IUPAC Name | (2S)-2-(1-amino-4-phenylimidazol-2-yl)sulfanyl-N-cyclohexylpropanamide |
| SMILES | C[C@H](Sc1nc(-c2ccccc2)cn1N)C(=O)NC1CCCCC1 |
| InChI | InChI=1S/C18H24N4OS/c1-13(17(23)20-15-10-6-3-7-11-15)24-18-21-16(12-22(18)19)14-8-4-2-5-9-14/h2,4-5,8-9,12-13,15H,3,6-7,10-11,19H2,1H3,(H,20,23)/t13-/m0/s1 |
| InChIKey | UIXYYBLUXOOWEN-ZDUSSCGKSA-N |
| XLogP | 3.19 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.48 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |