C13H16F3NO2 — CID 71523717
7,7-dimethyl-1-(2,2,2-trifluoroacetyl)-3,4,6,8-tetrahydro-2H-quinolin-5-one (PubChem CID 71523717) has the molecular formula C13H16F3NO2 and a molecular weight of 275.27 g/mol. Its IUPAC name is 7,7-dimethyl-1-(2,2,2-trifluoroacetyl)-3,4,6,8-tetrahydro-2H-quinolin-5-one.
| Compound Name | 7,7-dimethyl-1-(2,2,2-trifluoroacetyl)-3,4,6,8-tetrahydro-2H-quinolin-5-one |
|---|---|
| PubChem CID | 71523717 |
| Molecular Formula | C13H16F3NO2 |
| Molecular Weight | 275.27 g/mol |
| Exact Mass | 275.11 |
| IUPAC Name | 7,7-dimethyl-1-(2,2,2-trifluoroacetyl)-3,4,6,8-tetrahydro-2H-quinolin-5-one |
| SMILES | CC1(C)CC(=O)C2=C(C1)N(C(=O)C(F)(F)F)CCC2 |
| InChI | InChI=1S/C13H16F3NO2/c1-12(2)6-9-8(10(18)7-12)4-3-5-17(9)11(19)13(14,15)16/h3-7H2,1-2H3 |
| InChIKey | KSQWNRCMVHYRPE-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.27 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |