C24H30N2O4 — CID 71523746
(5R)-5-[4-(5,6-dimethoxy-3-oxo-1,2-dihydroinden-2-yl)butylamino]-5,6,7,8-tetrahydro-1H-quinolin-2-one (PubChem CID 71523746) has the molecular formula C24H30N2O4 and a molecular weight of 410.51 g/mol. Its IUPAC name is (5R)-5-[4-(5,6-dimethoxy-3-oxo-1,2-dihydroinden-2-yl)butylamino]-5,6,7,8-tetrahydro-1H-quinolin-2-one.
| Compound Name | (5R)-5-[4-(5,6-dimethoxy-3-oxo-1,2-dihydroinden-2-yl)butylamino]-5,6,7,8-tetrahydro-1H-quinolin-2-one |
|---|---|
| PubChem CID | 71523746 |
| Molecular Formula | C24H30N2O4 |
| Molecular Weight | 410.51 g/mol |
| Exact Mass | 410.22 |
| IUPAC Name | (5R)-5-[4-(5,6-dimethoxy-3-oxo-1,2-dihydroinden-2-yl)butylamino]-5,6,7,8-tetrahydro-1H-quinolin-2-one |
| SMILES | COc1cc2c(cc1OC)C(=O)C(CCCCN[C@@H]1CCCc3[nH]c(=O)ccc31)C2 |
| InChI | InChI=1S/C24H30N2O4/c1-29-21-13-16-12-15(24(28)18(16)14-22(21)30-2)6-3-4-11-25-19-7-5-8-20-17(19)9-10-23(27)26-20/h9-10,13-15,19,25H,3-8,11-12H2,1-2H3,(H,26,27)/t15?,19-/m1/s1 |
| InChIKey | FPPCSQYNOOZECN-XCWJXAQQSA-N |
| XLogP | 3.58 |
| TPSA | 80.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.51 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|