C11H14O5 — CID 71523869
methyl (4aS,6R,7aS)-6-hydroxy-7-methylidene-1-oxo-4,4a,5,6-tetrahydro-3H-cyclopenta[c]pyran-7a-carboxylate (PubChem CID 71523869) has the molecular formula C11H14O5 and a molecular weight of 226.23 g/mol. Its IUPAC name is methyl (4aS,6R,7aS)-6-hydroxy-7-methylidene-1-oxo-4,4a,5,6-tetrahydro-3H-cyclopenta[c]pyran-7a-carboxylate.
| Compound Name | methyl (4aS,6R,7aS)-6-hydroxy-7-methylidene-1-oxo-4,4a,5,6-tetrahydro-3H-cyclopenta[c]pyran-7a-carboxylate |
|---|---|
| PubChem CID | 71523869 |
| Molecular Formula | C11H14O5 |
| Molecular Weight | 226.23 g/mol |
| Exact Mass | 226.08 |
| IUPAC Name | methyl (4aS,6R,7aS)-6-hydroxy-7-methylidene-1-oxo-4,4a,5,6-tetrahydro-3H-cyclopenta[c]pyran-7a-carboxylate |
| SMILES | C=C1[C@H](O)C[C@@H]2CCOC(=O)[C@]12C(=O)OC |
| InChI | InChI=1S/C11H14O5/c1-6-8(12)5-7-3-4-16-10(14)11(6,7)9(13)15-2/h7-8,12H,1,3-5H2,2H3/t7-,8+,11+/m0/s1 |
| InChIKey | JJSHWFNGHSXUFE-VAOFZXAKSA-N |
| XLogP | 0.03 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.23 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|