C42H33N3O2 — CID 71523914
2-[(4R,5R)-4,5-diphenyl-4,5-dihydro-1,3-oxazol-2-yl]-N-[2-[(4R,5R)-4,5-diphenyl-4,5-dihydro-1,3-oxazol-2-yl]phenyl]aniline (PubChem CID 71523914) has the molecular formula C42H33N3O2 and a molecular weight of 611.75 g/mol. Its IUPAC name is 2-[(4R,5R)-4,5-diphenyl-4,5-dihydro-1,3-oxazol-2-yl]-N-[2-[(4R,5R)-4,5-diphenyl-4,5-dihydro-1,3-oxazol-2-yl]phenyl]aniline.
| Compound Name | 2-[(4R,5R)-4,5-diphenyl-4,5-dihydro-1,3-oxazol-2-yl]-N-[2-[(4R,5R)-4,5-diphenyl-4,5-dihydro-1,3-oxazol-2-yl]phenyl]aniline |
|---|---|
| PubChem CID | 71523914 |
| Molecular Formula | C42H33N3O2 |
| Molecular Weight | 611.75 g/mol |
| Exact Mass | 611.26 |
| IUPAC Name | 2-[(4R,5R)-4,5-diphenyl-4,5-dihydro-1,3-oxazol-2-yl]-N-[2-[(4R,5R)-4,5-diphenyl-4,5-dihydro-1,3-oxazol-2-yl]phenyl]aniline |
| SMILES | c1ccc([C@H]2N=C(c3ccccc3Nc3ccccc3C3=N[C@H](c4ccccc4)[C@@H](c4ccccc4)O3)O[C@@H]2c2ccccc2)cc1 |
| InChI | InChI=1S/C42H33N3O2/c1-5-17-29(18-6-1)37-39(31-21-9-3-10-22-31)46-41(44-37)33-25-13-15-27-35(33)43-36-28-16-14-26-34(36)42-45-38(30-19-7-2-8-20-30)40(47-42)32-23-11-4-12-24-32/h1-28,37-40,43H/t37-,38-,39-,40-/m1/s1 |
| InChIKey | RCEHTJHLGNWFOJ-JUFVCXMFSA-N |
| XLogP | 9.95 |
| TPSA | 55.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.75 |
| LogP ≤ 5 | 9.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |