C24H22N6O3 — CID 71523926
5-[2-(4-methoxyphenyl)ethyl]-11-[(4-methoxyphenyl)methyl]-3,5,7,9,11,13-hexazatricyclo[8.3.0.02,6]trideca-1(10),2,6,8,12-pentaen-4-one (PubChem CID 71523926) has the molecular formula C24H22N6O3 and a molecular weight of 442.48 g/mol. Its IUPAC name is 5-[2-(4-methoxyphenyl)ethyl]-11-[(4-methoxyphenyl)methyl]-3,5,7,9,11,13-hexazatricyclo[8.3.0.02,6]trideca-1(10),2,6,8,12-pentaen-4-one.
| Compound Name | 5-[2-(4-methoxyphenyl)ethyl]-11-[(4-methoxyphenyl)methyl]-3,5,7,9,11,13-hexazatricyclo[8.3.0.02,6]trideca-1(10),2,6,8,12-pentaen-4-one |
|---|---|
| PubChem CID | 71523926 |
| Molecular Formula | C24H22N6O3 |
| Molecular Weight | 442.48 g/mol |
| Exact Mass | 442.18 |
| IUPAC Name | 5-[2-(4-methoxyphenyl)ethyl]-11-[(4-methoxyphenyl)methyl]-3,5,7,9,11,13-hexazatricyclo[8.3.0.02,6]trideca-1(10),2,6,8,12-pentaen-4-one |
| SMILES | COc1ccc(CCn2c3ncnc4c(ncn4Cc4ccc(OC)cc4)c-3nc2=O)cc1 |
| InChI | InChI=1S/C24H22N6O3/c1-32-18-7-3-16(4-8-18)11-12-30-23-21(28-24(30)31)20-22(25-14-26-23)29(15-27-20)13-17-5-9-19(33-2)10-6-17/h3-10,14-15H,11-13H2,1-2H3 |
| InChIKey | BNYJAZZUVPNBJK-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 96.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.48 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |